The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl (S,E)-2-Cyano-4-((S)-3-(4-fluorophenyl)-2-(5-methylisoxazole-3-carboxamido)propanamido)-5-((S)-2-oxopiperidin-3-yl)pent-2-enoate ID: ALA4584210
PubChem CID: 155565955
Max Phase: Preclinical
Molecular Formula: C29H34FN5O6
Molecular Weight: 567.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N[C@H](/C=C(\C#N)C(=O)OC(C)(C)C)C[C@@H]2CCCNC2=O)no1
Standard InChI: InChI=1S/C29H34FN5O6/c1-17-12-24(35-41-17)27(38)34-23(13-18-7-9-21(30)10-8-18)26(37)33-22(14-19-6-5-11-32-25(19)36)15-20(16-31)28(39)40-29(2,3)4/h7-10,12,15,19,22-23H,5-6,11,13-14H2,1-4H3,(H,32,36)(H,33,37)(H,34,38)/b20-15+/t19-,22-,23-/m0/s1
Standard InChI Key: MRDXFCKRQZLLBD-LHSGJKJHSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
33.0793 -13.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7916 -13.3198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3670 -13.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0793 -14.5514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5081 -13.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2205 -13.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9328 -13.7275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5081 -14.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2205 -14.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2159 -15.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9274 -16.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6449 -15.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6422 -14.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9260 -14.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3577 -16.1990 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.6493 -13.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3616 -13.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0740 -13.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2798 -12.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4741 -12.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0622 -13.0377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6149 -13.6478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1398 -11.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7897 -13.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6493 -12.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9286 -11.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9314 -10.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2156 -10.4817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4982 -10.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5008 -11.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2170 -12.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6486 -10.4829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2205 -12.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0709 -12.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0724 -11.6589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7897 -14.5653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5104 -13.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2311 -13.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9519 -13.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2311 -14.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9473 -14.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
5 8 1 6
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
16 7 1 1
16 17 1 0
17 18 2 0
3 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 3 2 0
20 23 1 0
18 24 1 0
16 25 1 0
26 25 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
27 32 2 0
6 33 2 0
34 35 3 0
18 34 1 0
24 36 2 0
24 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
38 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 567.62Molecular Weight (Monoisotopic): 567.2493AlogP: 2.66#Rotatable Bonds: 10Polar Surface Area: 163.42Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.43CX Basic pKa: ┄CX LogP: 2.66CX LogD: 2.66Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: -0.63
References 1. Ma Y, Li L, He S, Shang C, Sun Y, Liu N, Meek TD, Wang Y, Shang L.. (2019) Application of Dually Activated Michael Acceptor to the Rational Design of Reversible Covalent Inhibitor for Enterovirus 71 3C Protease., 62 (13): [PMID:31184893 ] [10.1021/acs.jmedchem.9b00387 ]