The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Chloro-N-((S)-1-oxo-1-(((S,E)-6-oxo-1-phenylhept-4-en-3-yl)-amino)-3-phenylpropan-2-yl)benzamide ID: ALA4584291
PubChem CID: 155566273
Max Phase: Preclinical
Molecular Formula: C29H29ClN2O3
Molecular Weight: 489.02
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C29H29ClN2O3/c1-21(33)12-18-26(19-13-22-8-4-2-5-9-22)31-29(35)27(20-23-10-6-3-7-11-23)32-28(34)24-14-16-25(30)17-15-24/h2-12,14-18,26-27H,13,19-20H2,1H3,(H,31,35)(H,32,34)/b18-12+/t26-,27+/m1/s1
Standard InChI Key: VEOFVKMRRKERDB-MOKQZDJKSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
24.1464 -6.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8593 -6.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8593 -5.2016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5724 -6.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4292 -6.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7160 -6.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0029 -6.0267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2897 -6.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5724 -6.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8593 -6.4415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1462 -6.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1462 -5.2015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4330 -6.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4327 -7.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7179 -7.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0045 -7.2640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0022 -6.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7155 -6.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2914 -7.6745 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.5724 -5.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2897 -4.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2901 -3.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0007 -3.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7141 -3.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7163 -4.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0073 -5.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2897 -7.2626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7160 -7.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4292 -7.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4292 -8.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1463 -8.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1453 -9.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4277 -10.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7185 -9.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7158 -8.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
1 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
9 20 1 1
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
8 27 2 0
6 28 1 6
28 29 1 0
29 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
30 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.02Molecular Weight (Monoisotopic): 488.1867AlogP: 4.94#Rotatable Bonds: 11Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.78CX LogD: 5.78Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.06
References 1. Ettari R, Previti S, Maiorana S, Amendola G, Wagner A, Cosconati S, Schirmeister T, Hellmich UA, Zappalà M.. (2019) Optimization Strategy of Novel Peptide-Based Michael Acceptors for the Treatment of Human African Trypanosomiasis., 62 (23): [PMID:31714776 ] [10.1021/acs.jmedchem.9b00908 ]