(2S,4aS,6aS,6bR,8aR,10S,12aS,12bR,14bR)-10-hydroxy-N-(2-hydroxypropyl)-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2-carboxamide

ID: ALA4584517

PubChem CID: 155565836

Max Phase: Preclinical

Molecular Formula: C33H53NO4

Molecular Weight: 527.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(O)CNC(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1

Standard InChI:  InChI=1S/C33H53NO4/c1-20(35)19-34-27(38)30(5)14-13-29(4)15-16-32(7)21(22(29)18-30)17-23(36)26-31(6)11-10-25(37)28(2,3)24(31)9-12-33(26,32)8/h17,20,22,24-26,35,37H,9-16,18-19H2,1-8H3,(H,34,38)/t20?,22-,24-,25-,26+,29+,30-,31-,32+,33+/m0/s1

Standard InChI Key:  MDOHYKYUEICTNY-OKRBSWRTSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   35.8774  -13.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1643  -15.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8649  -14.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7299  -15.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4430  -14.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1643  -13.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4430  -13.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7299  -15.9370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5905  -13.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0168  -16.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3161  -12.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5905  -12.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2995  -13.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1685  -15.9370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7182  -11.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0168  -14.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5739  -15.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4513  -16.3515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3038  -15.9370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7258  -13.4578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2911  -14.7139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0167  -12.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0126  -13.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3036  -10.8086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3038  -15.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1561  -14.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7299  -14.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8649  -15.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5556  -11.5217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4231  -17.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5981  -17.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5865  -16.3515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9015  -11.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0126  -14.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4430  -15.5265    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.8649  -13.0473    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.7299  -16.7620    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.9625  -10.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7834  -10.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1903  -10.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1974  -11.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  5  1  0
  5  7  1  0
  6  1  2  0
  7  6  1  0
  8  4  1  0
  9  1  1  0
 10  8  1  0
 11 12  1  0
 12  9  1  0
 13  9  1  0
 14  2  1  0
 11 15  1  1
 16  4  1  0
 17  3  1  0
 18 14  1  0
 19 25  1  0
 20  7  2  0
 21 13  1  0
 22 23  1  0
 23 13  1  0
 24 15  2  0
 25 16  1  0
  2 26  1  1
  4 27  1  1
  3 28  1  6
 29 15  1  0
 30 10  1  0
 31 10  1  0
 19 32  1  1
 33 11  1  0
 13 34  1  1
  5 35  1  6
  9 36  1  1
  8 37  1  6
 17 21  1  0
  2  5  1  0
 11 22  1  0
  8 18  1  0
 10 19  1  0
 29 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4584517

    ---

Associated Targets(non-human)

Human alphaherpesvirus 1 (11089 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.79Molecular Weight (Monoisotopic): 527.3975AlogP: 5.83#Rotatable Bonds: 3
Polar Surface Area: 86.63Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 0.05CX LogP: 5.17CX LogD: 5.17
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: 2.59

References

1. Liang S, Li M, Yu X, Jin H, Zhang Y, Zhang L, Zhou D, Xiao S..  (2019)  Synthesis and structure-activity relationship studies of water-soluble β-cyclodextrin-glycyrrhetinic acid conjugates as potential anti-influenza virus agents.,  166  [PMID:30731401] [10.1016/j.ejmech.2019.01.074]

Source