The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-Chloro-4-({7-methyl-5-oxo-8-[meso-3,4,5-trimethylpiperazin-1-yl]-1,5-dihydro-2H-chromeno[3,4-c]pyridin-3(4H)-yl}carbonyl)phenyl]methanesulfonamide ID: ALA4584730
PubChem CID: 134560537
Max Phase: Preclinical
Molecular Formula: C28H33ClN4O5S
Molecular Weight: 573.12
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(N2C[C@@H](C)N(C)[C@@H](C)C2)ccc2c3c(c(=O)oc12)CN(C(=O)c1ccc(NS(C)(=O)=O)c(Cl)c1)CC3
Standard InChI: InChI=1S/C28H33ClN4O5S/c1-16-13-33(14-17(2)31(16)4)25-9-7-21-20-10-11-32(15-22(20)28(35)38-26(21)18(25)3)27(34)19-6-8-24(23(29)12-19)30-39(5,36)37/h6-9,12,16-17,30H,10-11,13-15H2,1-5H3/t16-,17+
Standard InChI Key: CKHTVWRHUUKZSV-CALCHBBNSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
27.3157 -15.2553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0276 -14.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7353 -15.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7353 -16.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0276 -16.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3157 -16.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6080 -16.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6110 -17.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3149 -17.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0268 -17.2974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9029 -17.7106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9029 -18.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1907 -18.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4827 -18.5300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4826 -17.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1907 -17.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7746 -17.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7746 -18.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1907 -19.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8958 -16.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4431 -16.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1509 -16.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1509 -15.2554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4431 -14.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8631 -14.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8631 -14.0282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5712 -15.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2795 -14.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9881 -15.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9881 -16.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2820 -16.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5712 -16.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2820 -17.3007 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.6962 -16.4823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4042 -16.0746 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.1123 -16.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8171 -15.3646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9977 -15.3646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0276 -14.0284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
5 10 1 0
8 11 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
11 16 1 0
15 17 1 1
14 18 1 0
13 19 1 1
7 20 1 0
4 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
3 24 1 0
23 25 1 0
25 26 2 0
25 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
31 33 1 0
30 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
35 38 2 0
2 39 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.12Molecular Weight (Monoisotopic): 572.1860AlogP: 3.85#Rotatable Bonds: 4Polar Surface Area: 103.17Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.01CX Basic pKa: 8.13CX LogP: 2.45CX LogD: 1.92Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.47Np Likeness Score: -1.20
References 1. Kawai J, Toki T, Ota M, Inoue H, Takata Y, Asahi T, Suzuki M, Shimada T, Ono K, Suzuki K, Takaishi S, Ohki H, Matsui S, Tsutsumi S, Hirota Y, Nakayama K.. (2019) Discovery of a Potent, Selective, and Orally Available MTHFD2 Inhibitor (DS18561882) with in Vivo Antitumor Activity., 62 (22): [PMID:31638799 ] [10.1021/acs.jmedchem.9b01113 ]