The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Schwarzinicine B ID: ALA4584880
PubChem CID: 155561872
Max Phase: Preclinical
Molecular Formula: C31H41NO6
Molecular Weight: 523.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCC(Cc2ccc(OC)c(OC)c2)N(C)CCc2ccc(OC)c(OC)c2)cc1OC
Standard InChI: InChI=1S/C31H41NO6/c1-32(17-16-23-10-14-27(34-3)30(20-23)37-6)25(18-24-11-15-28(35-4)31(21-24)38-7)12-8-22-9-13-26(33-2)29(19-22)36-5/h9-11,13-15,19-21,25H,8,12,16-18H2,1-7H3
Standard InChI Key: CSPQUCNKCHGDKG-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
3.5967 -16.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3047 -15.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0089 -16.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0089 -16.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3073 -17.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5967 -16.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8845 -17.2610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8845 -18.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7211 -17.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -16.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1373 -17.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8453 -16.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5575 -17.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2658 -16.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9703 -17.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9703 -18.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2684 -18.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5575 -18.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6825 -18.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3906 -18.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6825 -16.8475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6825 -16.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -16.0286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1373 -15.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1373 -14.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8453 -14.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8457 -13.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5553 -13.1652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2637 -13.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2660 -14.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5577 -14.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9718 -13.1654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6840 -13.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5553 -12.3457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8432 -11.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7211 -15.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8845 -15.6215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1765 -16.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
15 21 1 0
21 22 1 0
10 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
32 33 1 0
28 34 1 0
34 35 1 0
23 36 1 0
1 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.67Molecular Weight (Monoisotopic): 523.2934AlogP: 5.46#Rotatable Bonds: 15Polar Surface Area: 58.62Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.24CX LogP: 5.79CX LogD: 3.03Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -0.08
References 1. Krishnan P, Lee FK, Yap VA, Low YY, Kam TS, Yong KT, Ting KN, Lim KH.. (2020) Schwarzinicines A-G, 1,4-Diarylbutanoid-Phenethylamine Conjugates from the Leaves of Ficus schwarzii., 83 (1): [PMID:31935094 ] [10.1021/acs.jnatprod.9b01160 ]