Schwarzinicine B

ID: ALA4584880

PubChem CID: 155561872

Max Phase: Preclinical

Molecular Formula: C31H41NO6

Molecular Weight: 523.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCC(Cc2ccc(OC)c(OC)c2)N(C)CCc2ccc(OC)c(OC)c2)cc1OC

Standard InChI:  InChI=1S/C31H41NO6/c1-32(17-16-23-10-14-27(34-3)30(20-23)37-6)25(18-24-11-15-28(35-4)31(21-24)38-7)12-8-22-9-13-26(33-2)29(19-22)36-5/h9-11,13-15,19-21,25H,8,12,16-18H2,1-7H3

Standard InChI Key:  CSPQUCNKCHGDKG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    3.5967  -16.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3047  -15.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0089  -16.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0089  -16.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3073  -17.2587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5967  -16.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8845  -17.2610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8845  -18.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7211  -17.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4292  -16.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1373  -17.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8453  -16.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5575  -17.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2658  -16.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9703  -17.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9703  -18.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2684  -18.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5575  -18.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6825  -18.4867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3906  -18.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6825  -16.8475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6825  -16.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4292  -16.0286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1373  -15.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1373  -14.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8453  -14.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8457  -13.5743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5553  -13.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2637  -13.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2660  -14.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5577  -14.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9718  -13.1654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6840  -13.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5553  -12.3457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8432  -11.9381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7211  -15.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8845  -15.6215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1765  -16.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 15 21  1  0
 21 22  1  0
 10 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 32 33  1  0
 28 34  1  0
 34 35  1  0
 23 36  1  0
  1 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4584880

    ---

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Aorta (2975 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.67Molecular Weight (Monoisotopic): 523.2934AlogP: 5.46#Rotatable Bonds: 15
Polar Surface Area: 58.62Molecular Species: BASEHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.24CX LogP: 5.79CX LogD: 3.03
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -0.08

References

1. Krishnan P, Lee FK, Yap VA, Low YY, Kam TS, Yong KT, Ting KN, Lim KH..  (2020)  Schwarzinicines A-G, 1,4-Diarylbutanoid-Phenethylamine Conjugates from the Leaves of Ficus schwarzii.,  83  (1): [PMID:31935094] [10.1021/acs.jnatprod.9b01160]

Source