The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-1-(((S)-1-(((S)-1-(isobutylamino)-5-methyl-1,2-dioxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate ID: ALA4584892
PubChem CID: 155561976
Max Phase: Preclinical
Molecular Formula: C31H50N4O6
Molecular Weight: 574.76
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CNC(=O)C(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C31H50N4O6/c1-19(2)14-24(27(36)30(39)32-17-22(7)8)33-28(37)25(15-20(3)4)34-29(38)26(16-21(5)6)35-31(40)41-18-23-12-10-9-11-13-23/h9-13,19-22,24-26H,14-18H2,1-8H3,(H,32,39)(H,33,37)(H,34,38)(H,35,40)/t24-,25-,26-/m0/s1
Standard InChI Key: SIOGLHVKIIFXRC-GSDHBNRESA-N
Molfile:
RDKit 2D
41 41 0 0 0 0 0 0 0 0999 V2000
4.6459 -9.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3604 -9.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9314 -9.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6459 -10.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9314 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2169 -8.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2199 -7.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5062 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7909 -7.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7935 -8.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5077 -8.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0748 -9.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7893 -9.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5038 -9.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7893 -8.6543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0748 -10.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7844 -11.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7845 -11.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4988 -10.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2182 -9.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9327 -9.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2182 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9334 -8.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6513 -8.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9265 -7.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9327 -10.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6472 -9.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3616 -9.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0761 -9.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3616 -10.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0761 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7906 -8.2418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3616 -8.2418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0761 -11.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0761 -11.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7906 -10.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7906 -9.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5051 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2196 -8.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9341 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2196 -7.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
12 16 1 6
16 17 1 0
17 18 1 0
17 19 1 0
14 20 1 0
20 21 1 0
20 22 1 1
22 23 1 0
23 24 1 0
23 25 1 0
21 26 2 0
21 27 1 0
27 28 1 0
28 29 1 0
28 30 1 6
29 31 1 0
31 32 1 0
31 33 2 0
30 34 1 0
34 35 1 0
34 36 1 0
29 37 2 0
32 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.76Molecular Weight (Monoisotopic): 574.3730AlogP: 3.73#Rotatable Bonds: 17Polar Surface Area: 142.70Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.23CX Basic pKa: ┄CX LogP: 5.22CX LogD: 5.22Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -0.21
References 1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M.. (2019) Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors., 10 (7): [PMID:31312413 ] [10.1021/acsmedchemlett.9b00233 ]