4-(cyclopentyl(pyrimidin-4-ylmethyl)amino)-6-morpholino-1,3,5-triazine-2-carbonitrile

ID: ALA4585022

PubChem CID: 155562235

Max Phase: Preclinical

Molecular Formula: C18H22N8O

Molecular Weight: 366.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1nc(N2CCOCC2)nc(N(Cc2ccncn2)C2CCCC2)n1

Standard InChI:  InChI=1S/C18H22N8O/c19-11-16-22-17(25-7-9-27-10-8-25)24-18(23-16)26(15-3-1-2-4-15)12-14-5-6-20-13-21-14/h5-6,13,15H,1-4,7-10,12H2

Standard InChI Key:  SIYUTFCZRAHSMQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   27.2480  -18.1928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2480  -19.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9532  -19.4145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6585  -19.0100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6585  -18.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9532  -17.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3656  -19.4196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3613  -20.2369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0676  -20.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7769  -20.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7754  -19.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0686  -19.0115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4823  -19.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1891  -18.5972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0660  -21.4636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3575  -21.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7729  -21.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8604  -22.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6594  -22.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0694  -22.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5237  -21.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3559  -22.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6462  -23.0940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6443  -23.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3517  -24.3212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0626  -23.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0610  -23.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  3  0
  9 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 16 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4585022

    ---

Associated Targets(Human)

CTSL Tclin Cathepsin L (3852 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.43Molecular Weight (Monoisotopic): 366.1917AlogP: 1.32#Rotatable Bonds: 5
Polar Surface Area: 103.95Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.59CX LogP: 2.86CX LogD: 2.86
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.77Np Likeness Score: -1.75

References

1. Meanwell NA..  (2018)  Fluorine and Fluorinated Motifs in the Design and Application of Bioisosteres for Drug Design.,  61  (14): [PMID:29400967] [10.1021/acs.jmedchem.7b01788]

Source