(S)-N-(1-(3-(4-(3-aminopropylamino)butylamino)propylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)cyclopentanecarboxamide

ID: ALA4585225

PubChem CID: 155564442

Max Phase: Preclinical

Molecular Formula: C25H43N5O3

Molecular Weight: 461.65

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  NCCCNCCCCNCCCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C1CCCC1

Standard InChI:  InChI=1S/C25H43N5O3/c26-13-5-16-27-14-3-4-15-28-17-6-18-29-25(33)23(19-20-9-11-22(31)12-10-20)30-24(32)21-7-1-2-8-21/h9-12,21,23,27-28,31H,1-8,13-19,26H2,(H,29,33)(H,30,32)/t23-/m0/s1

Standard InChI Key:  QYFZGNQKVGYCKF-QHCPKHFHSA-N

Molfile:  

 
     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   22.7575  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4652  -16.9216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0498  -16.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3421  -17.3302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3421  -18.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6344  -18.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0498  -18.5560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0498  -16.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3421  -15.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3451  -14.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6382  -14.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9295  -14.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9322  -15.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6396  -16.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2213  -14.4701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1730  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8807  -16.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5884  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2961  -16.9216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0038  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7115  -16.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4192  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1269  -16.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8346  -17.3302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.5423  -16.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2500  -17.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9577  -16.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6655  -17.3302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7575  -18.1474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8885  -18.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3417  -18.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7503  -19.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5496  -19.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  3  8  1  1
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
  2 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
  1 29  2  0
  6 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33  6  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4585225

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 461.65

Molecular Weight (Monoisotopic): 461.3366

AlogP: 1.42

#Rotatable Bonds: 17

Polar Surface Area: 128.51

Molecular Species: BASE

HBA: 6

HBD: 6

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 7

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 9.41

CX Basic pKa: 10.76

CX LogP: -0.49

CX LogD: -5.45

Aromatic Rings: 1

Heavy Atoms: 33

QED Weighted: 0.19

Np Likeness Score: -0.22

References

1. Kachel HS, Franzyk H, Mellor IR..  (2019)  Philanthotoxin Analogues That Selectively Inhibit Ganglionic Nicotinic Acetylcholine Receptors with Exceptional Potency.,  62  (13): [PMID:31244109] [10.1021/acs.jmedchem.9b00519]

Source

Source(1):

• Scientific Literature