(4aS,7aS)-methyl 7-((4-(4-chlorobenzyl)piperazin-1-yl)methyl)-2-isopropyl-1-oxo-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate dihydrochloride

ID: ALA4585237

PubChem CID: 155564473

Max Phase: Preclinical

Molecular Formula: C25H34Cl3N3O3

Molecular Weight: 458.00

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)C1=CN(C(C)C)C(=O)[C@@H]2C(CN3CCN(Cc4ccc(Cl)cc4)CC3)=CC[C@H]12.Cl.Cl

Standard InChI:  InChI=1S/C25H32ClN3O3.2ClH/c1-17(2)29-16-22(25(31)32-3)21-9-6-19(23(21)24(29)30)15-28-12-10-27(11-13-28)14-18-4-7-20(26)8-5-18;;/h4-8,16-17,21,23H,9-15H2,1-3H3;2*1H/t21-,23-;;/m1../s1

Standard InChI Key:  AAYSXRQNQXBJAD-GBUPLUEPSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   38.8950   -3.5886    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.1635   -2.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4541   -3.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4541   -2.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6729   -2.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1924   -2.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6728   -3.6450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4500   -1.7458    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.4500   -4.2098    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.1635   -1.3331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8753   -0.9204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4516   -0.9204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5872   -1.3331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1539   -3.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1503   -4.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8673   -3.3869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8703   -2.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4202   -4.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6168   -4.5962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3642   -5.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0659   -3.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2624   -4.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0099   -4.9359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5608   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2064   -5.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6555   -4.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9151   -3.7212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3650   -3.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5606   -3.2798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3092   -4.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8569   -4.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5738   -3.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5716   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2827   -3.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0128   -2.6733    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.3084   -6.2507    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3 14  1  0
 17  2  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  3  1  0
  4  8  1  1
  3  9  1  1
  2 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
  7 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 20 24  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 16 32  1  0
 32 33  1  0
 32 34  1  0
 29 35  1  0
M  END

Associated Targets(non-human)

Cortical neurone (598 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.00Molecular Weight (Monoisotopic): 457.2132AlogP: 3.33#Rotatable Bonds: 6
Polar Surface Area: 53.09Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.67CX LogP: 2.98CX LogD: 2.53
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.28

References

1. Zhang Z, Wang Y, Zhang Y, Li J, Huang W, Wang L..  (2019)  The synthesis and biological evaluation of novel gardenamide A derivatives as multifunctional neuroprotective agents.,  10  (7): [PMID:31391892] [10.1039/C9MD00211A]

Source