The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(azetidin-3-yloxy)-N-(6-(azetidin-3-yloxy)-4'-fluorobiphenyl-3-yl)-3',4'-difluorobiphenyl-3-carboxamide dihydrochloride ID: ALA4585293
PubChem CID: 155562354
Max Phase: Preclinical
Molecular Formula: C31H28Cl2F3N3O3
Molecular Weight: 545.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.O=C(Nc1ccc(OC2CNC2)c(-c2ccc(F)cc2)c1)c1ccc(OC2CNC2)c(-c2ccc(F)c(F)c2)c1
Standard InChI: InChI=1S/C31H26F3N3O3.2ClH/c32-21-5-1-18(2-6-21)26-13-22(7-10-30(26)40-24-16-36-17-24)37-31(38)20-4-9-29(39-23-14-35-15-23)25(11-20)19-3-8-27(33)28(34)12-19;;/h1-13,23-24,35-36H,14-17H2,(H,37,38);2*1H
Standard InChI Key: XRQMNVDTXYYKLT-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
11.9771 -3.0171 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.5220 -4.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5209 -5.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2289 -5.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9386 -5.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9358 -4.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2271 -4.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2287 -6.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5209 -6.9528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9363 -6.9531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2247 -3.2726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9361 -7.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2279 -8.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2274 -8.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9355 -9.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6457 -8.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6427 -8.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3547 -9.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3547 -10.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0629 -10.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7702 -10.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7649 -9.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0561 -8.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4798 -10.6124 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6419 -4.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3484 -4.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0541 -4.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0515 -3.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6345 -3.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7571 -2.8519 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.9364 -10.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7632 -4.4884 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.3384 -2.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2291 -10.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5158 -2.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2975 -2.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5088 -2.2899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7227 -3.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4433 -10.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2326 -11.2070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0222 -11.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9828 -9.6914 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
8 9 2 0
8 10 1 0
7 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
6 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 33 1 0
29 25 1 0
28 30 1 0
15 31 1 0
27 32 1 0
29 33 2 0
34 31 1 6
35 11 1 6
35 36 1 0
36 37 1 0
37 38 1 0
38 35 1 0
34 39 1 0
39 40 1 0
40 41 1 0
41 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.56Molecular Weight (Monoisotopic): 545.1926AlogP: 5.39#Rotatable Bonds: 8Polar Surface Area: 71.62Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.85CX LogP: 5.52CX LogD: 3.17Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.28Np Likeness Score: -1.00
References 1. (2018) Substituted n-([1,1''-biphenyl]-3-yl)-[1,1''-biphenyl]-3-carboxamide analogs as inhibitors for beta-catenin/b-cell lymphoma 9 interactions,