6-(azetidin-3-yloxy)-N-(6-(azetidin-3-yloxy)-4'-fluorobiphenyl-3-yl)-3',4'-difluorobiphenyl-3-carboxamide dihydrochloride

ID: ALA4585293

PubChem CID: 155562354

Max Phase: Preclinical

Molecular Formula: C31H28Cl2F3N3O3

Molecular Weight: 545.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.O=C(Nc1ccc(OC2CNC2)c(-c2ccc(F)cc2)c1)c1ccc(OC2CNC2)c(-c2ccc(F)c(F)c2)c1

Standard InChI:  InChI=1S/C31H26F3N3O3.2ClH/c32-21-5-1-18(2-6-21)26-13-22(7-10-30(26)40-24-16-36-17-24)37-31(38)20-4-9-29(39-23-14-35-15-23)25(11-20)19-3-8-27(33)28(34)12-19;;/h1-13,23-24,35-36H,14-17H2,(H,37,38);2*1H

Standard InChI Key:  XRQMNVDTXYYKLT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   11.9771   -3.0171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.5220   -4.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5209   -5.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2289   -5.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9386   -5.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9358   -4.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2271   -4.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2287   -6.5443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5209   -6.9528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9363   -6.9531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2247   -3.2726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9361   -7.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2279   -8.1744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2274   -8.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9355   -9.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6457   -8.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6427   -8.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3547   -9.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3547  -10.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0629  -10.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7702  -10.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7649   -9.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0561   -8.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4798  -10.6124    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.6419   -4.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3484   -4.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0541   -4.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0515   -3.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6345   -3.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7571   -2.8519    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.9364  -10.2176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7632   -4.4884    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.3384   -2.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2291  -10.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5158   -2.8661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2975   -2.0760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5088   -2.2899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7227   -3.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4433  -10.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2326  -11.2070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0222  -11.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9828   -9.6914    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  4  8  1  0
  8  9  2  0
  8 10  1  0
  7 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
  6 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 33  1  0
 29 25  1  0
 28 30  1  0
 15 31  1  0
 27 32  1  0
 29 33  2  0
 34 31  1  6
 35 11  1  6
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 35  1  0
 34 39  1  0
 39 40  1  0
 40 41  1  0
 41 34  1  0
M  END

Associated Targets(Human)

MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TCF7L2 Tbio Cadherin-1/Transcription factor 7-like 2 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CTNNB1 Tchem beta-catenin-B-cell lymphoma 9 protein complex (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.56Molecular Weight (Monoisotopic): 545.1926AlogP: 5.39#Rotatable Bonds: 8
Polar Surface Area: 71.62Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.85CX LogP: 5.52CX LogD: 3.17
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.28Np Likeness Score: -1.00

References

1.  (2018)  Substituted n-([1,1''-biphenyl]-3-yl)-[1,1''-biphenyl]-3-carboxamide analogs as inhibitors for beta-catenin/b-cell lymphoma 9 interactions, 

Source