The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((2-Bromophenyl)amino)-6-chloro-N-(4-((6,7-dimethoxyquinolin-4-yl)oxy)phenyl)nicotinamide ID: ALA4585471
PubChem CID: 155562320
Max Phase: Preclinical
Molecular Formula: C29H22BrClN4O4
Molecular Weight: 605.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nccc(Oc3ccc(NC(=O)c4cnc(Cl)cc4Nc4ccccc4Br)cc3)c2cc1OC
Standard InChI: InChI=1S/C29H22BrClN4O4/c1-37-26-13-19-23(14-27(26)38-2)32-12-11-25(19)39-18-9-7-17(8-10-18)34-29(36)20-16-33-28(31)15-24(20)35-22-6-4-3-5-21(22)30/h3-16H,1-2H3,(H,33,35)(H,34,36)
Standard InChI Key: QVQFQLISGICZSW-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
2.6524 -5.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6512 -6.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3593 -6.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3575 -4.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0661 -5.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0669 -6.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7754 -6.6291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4837 -6.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4789 -5.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7698 -4.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9446 -4.9982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9432 -6.6342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9426 -7.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9444 -4.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7655 -4.1756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4710 -3.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1763 -4.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8814 -3.7598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8775 -2.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1626 -2.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4605 -2.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5825 -2.5285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2929 -2.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2983 -3.7496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9961 -2.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7082 -2.9230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4105 -2.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4068 -1.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6947 -1.2883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9863 -1.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7142 -3.7402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4249 -4.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4286 -4.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1384 -5.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8441 -4.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8355 -4.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1251 -3.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1121 -1.2797 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.1149 -2.9093 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 1 0
2 12 1 0
12 13 1 0
11 14 1 0
10 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 25 1 0
23 24 2 0
25 26 1 0
25 30 2 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
26 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
28 38 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.88Molecular Weight (Monoisotopic): 604.0513AlogP: 7.85#Rotatable Bonds: 8Polar Surface Area: 94.60Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.90CX LogP: 7.52CX LogD: 7.51Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: -1.04
References 1. Qi B, Xu X, Yang Y, He H, Yue X.. (2019) Optimization and biological evaluation of nicotinamide derivatives as Aurora kinase inhibitors., 27 (17): [PMID:31307762 ] [10.1016/j.bmc.2019.07.016 ]