The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(4-(3-(3,4,5-trimethoxyphenyl)acryloyl)phenoxy)ethyl pyrrolidine-1-carbodithioate ID: ALA4585563
PubChem CID: 155557926
Max Phase: Preclinical
Molecular Formula: C25H29NO5S2
Molecular Weight: 487.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)c2ccc(OCCSC(=S)N3CCCC3)cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C25H29NO5S2/c1-28-22-16-18(17-23(29-2)24(22)30-3)6-11-21(27)19-7-9-20(10-8-19)31-14-15-33-25(32)26-12-4-5-13-26/h6-11,16-17H,4-5,12-15H2,1-3H3/b11-6+
Standard InChI Key: UAPXBSVFPFTIQZ-IZZDOVSWSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
22.5636 -18.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2713 -18.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9790 -18.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2713 -17.7430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6867 -18.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3944 -18.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3921 -19.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0990 -20.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8076 -19.7869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8050 -18.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0976 -18.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8563 -18.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1491 -18.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1486 -19.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8613 -20.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5656 -19.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4415 -20.1927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7332 -19.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0261 -20.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3178 -19.7870 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.6106 -20.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9024 -19.7889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6117 -21.0137 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8124 -18.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0128 -18.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6051 -19.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1528 -20.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5159 -20.1945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5170 -21.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5113 -18.5544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2204 -18.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0986 -21.0127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8061 -21.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
1 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 1 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 22 1 0
9 28 1 0
28 29 1 0
10 30 1 0
30 31 1 0
8 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.64Molecular Weight (Monoisotopic): 487.1487AlogP: 5.10#Rotatable Bonds: 10Polar Surface Area: 57.23Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.92CX LogD: 4.92Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.20Np Likeness Score: -0.58
References 1. Fu DJ, Zhang SY, Liu YC, Zhang L, Liu JJ, Song J, Zhao RH, Li F, Sun HH, Liu HM, Zhang YB.. (2016) Design, synthesis and antiproliferative activity studies of novel dithiocarbamate-chalcone derivates., 26 (16): [PMID:27423479 ] [10.1016/j.bmcl.2016.07.012 ]