(E)-2-(4-(3-(3,4,5-trimethoxyphenyl)acryloyl)phenoxy)ethyl pyrrolidine-1-carbodithioate

ID: ALA4585563

PubChem CID: 155557926

Max Phase: Preclinical

Molecular Formula: C25H29NO5S2

Molecular Weight: 487.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)c2ccc(OCCSC(=S)N3CCCC3)cc2)cc(OC)c1OC

Standard InChI:  InChI=1S/C25H29NO5S2/c1-28-22-16-18(17-23(29-2)24(22)30-3)6-11-21(27)19-7-9-20(10-8-19)31-14-15-33-25(32)26-12-4-5-13-26/h6-11,16-17H,4-5,12-15H2,1-3H3/b11-6+

Standard InChI Key:  UAPXBSVFPFTIQZ-IZZDOVSWSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   22.5636  -18.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2713  -18.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9790  -18.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2713  -17.7430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6867  -18.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3944  -18.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3921  -19.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0990  -20.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8076  -19.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8050  -18.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0976  -18.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8563  -18.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1491  -18.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1486  -19.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8613  -20.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5656  -19.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4415  -20.1927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7332  -19.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0261  -20.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3178  -19.7870    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.6106  -20.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9024  -19.7889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6117  -21.0137    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.8124  -18.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0128  -18.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6051  -19.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1528  -20.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5159  -20.1945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5170  -21.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5113  -18.5544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2204  -18.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0986  -21.0127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8061  -21.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  1 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16  1  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 22  1  0
  9 28  1  0
 28 29  1  0
 10 30  1  0
 30 31  1  0
  8 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4585563

    ---

Associated Targets(Human)

ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-N-SH (1499 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.64Molecular Weight (Monoisotopic): 487.1487AlogP: 5.10#Rotatable Bonds: 10
Polar Surface Area: 57.23Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.92CX LogD: 4.92
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.20Np Likeness Score: -0.58

References

1. Fu DJ, Zhang SY, Liu YC, Zhang L, Liu JJ, Song J, Zhao RH, Li F, Sun HH, Liu HM, Zhang YB..  (2016)  Design, synthesis and antiproliferative activity studies of novel dithiocarbamate-chalcone derivates.,  26  (16): [PMID:27423479] [10.1016/j.bmcl.2016.07.012]

Source