The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(dodecane-1,12-diyl)bis(N'-hydroxy-3,4-dimethoxybenzothioamide) ID: ALA4585571
PubChem CID: 155557957
Max Phase: Preclinical
Molecular Formula: C30H46N4O6
Molecular Weight: 558.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C(=N/O)NCCCCCCCCCCCCN/C(=N\O)c2ccc(OC)c(OC)c2)cc1OC
Standard InChI: InChI=1S/C30H46N4O6/c1-37-25-17-15-23(21-27(25)39-3)29(33-35)31-19-13-11-9-7-5-6-8-10-12-14-20-32-30(34-36)24-16-18-26(38-2)28(22-24)40-4/h15-18,21-22,35-36H,5-14,19-20H2,1-4H3,(H,31,33)(H,32,34)
Standard InChI Key: JWFRVGKTNGFHRO-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
21.4194 -9.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4182 -10.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1331 -10.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8494 -10.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8466 -9.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1312 -9.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5596 -9.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2755 -9.4118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5564 -8.1770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2693 -7.7618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9885 -8.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7045 -9.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4174 -8.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1334 -9.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8463 -8.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5623 -9.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2752 -8.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9912 -9.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7042 -8.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4201 -9.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1331 -8.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8491 -9.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5620 -8.9642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2780 -9.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9909 -8.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2811 -10.1990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5683 -10.6142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7064 -9.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4187 -8.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4161 -8.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6951 -7.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9856 -8.1376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1329 -11.4860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4183 -11.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7034 -10.6601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9893 -10.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1285 -7.7143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8450 -8.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6890 -6.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4005 -6.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
25 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 25 1 0
3 33 1 0
33 34 1 0
2 35 1 0
35 36 1 0
30 37 1 0
37 38 1 0
31 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.72Molecular Weight (Monoisotopic): 558.3417AlogP: 5.77#Rotatable Bonds: 19Polar Surface Area: 126.16Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.53CX Basic pKa: 15.14CX LogP: 5.67CX LogD: 5.63Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.06Np Likeness Score: -0.13
References 1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y.. (2019) Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials., 29 (16): [PMID:31255483 ] [10.1016/j.bmcl.2019.06.045 ]