6-(2-((1-methyl-1H-pyrazol-5-yl)amino)pyrimidin-4-yl)-2-(pyridin-2-ylmethyl)isoindolin-1-one

ID: ALA4585624

PubChem CID: 155566828

Max Phase: Preclinical

Molecular Formula: C22H19N7O

Molecular Weight: 397.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1nccc1Nc1nccc(-c2ccc3c(c2)C(=O)N(Cc2ccccn2)C3)n1

Standard InChI:  InChI=1S/C22H19N7O/c1-28-20(8-11-25-28)27-22-24-10-7-19(26-22)15-5-6-16-13-29(21(30)18(16)12-15)14-17-4-2-3-9-23-17/h2-12H,13-14H2,1H3,(H,24,26,27)

Standard InChI Key:  VTNWILMIIPGHLR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    7.3904  -21.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3893  -22.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0973  -22.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0956  -20.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6847  -20.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6859  -20.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9789  -19.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2703  -20.0209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2731  -20.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9807  -21.2469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8042  -21.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8090  -22.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5890  -22.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0664  -21.6453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5813  -20.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8292  -20.2072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8835  -21.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2880  -20.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5670  -21.2535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5700  -22.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1050  -20.9283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5094  -20.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0966  -19.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2752  -19.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8745  -20.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9097  -22.5576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1652  -23.3338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9824  -23.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2319  -22.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1312  -22.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 12  2  0
 11  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1  5  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 14 17  1  0
 17 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 18  1  0
 20 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 20  2  0
 26 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4585624

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.44Molecular Weight (Monoisotopic): 397.1651AlogP: 3.17#Rotatable Bonds: 5
Polar Surface Area: 88.83Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.21CX Basic pKa: 4.17CX LogP: 2.36CX LogD: 2.36
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.53

References

1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y..  (2019)  Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design.,  164  [PMID:30605831] [10.1016/j.ejmech.2018.12.040]

Source