The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-(2-chloro-5-{1-[2-(piperazin-1-yl)ethyl]-1H-pyrazol-4-yl}phenyl)-1,3-oxazole-4-carboxamide ID: ALA4585820
PubChem CID: 142393787
Max Phase: Preclinical
Molecular Formula: C19H22ClN7O2
Molecular Weight: 415.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(C(=O)Nc2cc(-c3cnn(CCN4CCNCC4)c3)ccc2Cl)co1
Standard InChI: InChI=1S/C19H22ClN7O2/c20-15-2-1-13(9-16(15)24-18(28)17-12-29-19(21)25-17)14-10-23-27(11-14)8-7-26-5-3-22-4-6-26/h1-2,9-12,22H,3-8H2,(H2,21,25)(H,24,28)
Standard InChI Key: BRIPLYFWWJLVON-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
9.8057 -10.5219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2279 -9.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0121 -8.6234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0852 -9.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9613 -10.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0757 -8.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0757 -7.3440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1075 -9.1187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0980 -8.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0980 -7.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1299 -6.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1204 -7.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1204 -8.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1299 -9.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1522 -9.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2301 -8.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9925 -9.5872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3539 -10.5826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2202 -10.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7885 -11.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9563 -11.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3909 -12.9109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6577 -13.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0922 -14.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2600 -15.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9932 -14.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5392 -13.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1075 -6.7662 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.0723 -9.3663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
13 15 1 0
16 15 1 0
17 16 2 0
18 17 1 0
18 19 1 0
15 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
22 27 1 0
10 28 1 0
2 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.89Molecular Weight (Monoisotopic): 415.1524AlogP: 1.93#Rotatable Bonds: 6Polar Surface Area: 114.24Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.93CX Basic pKa: 9.24CX LogP: 1.41CX LogD: -0.42Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -2.02
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,