Methyl N-[(10R,14S)-14-(2,6-Difluoro-4-methylbenzamido)-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.0(2,7)]nonadeca-1-(19),2(7),3,5,15,17-hexaen-5-yl]carbamate

ID: ALA4585824

PubChem CID: 155567050

Max Phase: Preclinical

Molecular Formula: C28H28F2N4O4

Molecular Weight: 522.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](NC(=O)c1c(F)cc(C)cc1F)c1cc-2ccn1

Standard InChI:  InChI=1S/C28H28F2N4O4/c1-15-11-20(29)25(21(30)12-15)27(36)33-22-6-4-5-16(2)26(35)34-23-14-18(32-28(37)38-3)7-8-19(23)17-9-10-31-24(22)13-17/h7-14,16,22H,4-6H2,1-3H3,(H,32,37)(H,33,36)(H,34,35)/t16-,22+/m1/s1

Standard InChI Key:  UFXJPWDSTBLEDM-ZHRRBRCNSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    7.4208  -27.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1326  -27.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4208  -28.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1326  -26.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8444  -25.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5563  -26.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2681  -25.9644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5563  -27.1943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2681  -27.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2658  -28.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9768  -28.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6855  -28.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6829  -27.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9754  -27.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5569  -28.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8454  -28.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1334  -28.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1317  -29.6563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8478  -30.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5569  -29.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7097  -28.8382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0012  -28.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2901  -28.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9998  -27.6096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5808  -28.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8702  -28.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8712  -29.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5887  -30.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2964  -29.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5804  -27.6119    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.0110  -30.0682    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1606  -30.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8444  -25.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3932  -27.1885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1065  -27.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1094  -28.4201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8169  -27.1835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5302  -27.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 15  1  0
 17  3  1  0
  3 21  1  1
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 25 30  1  0
 29 31  1  0
 27 32  1  0
  5 33  1  1
 13 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4585824

    ---

Associated Targets(Human)

F11 Tchem Coagulation factor XI (1733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (7708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.55Molecular Weight (Monoisotopic): 522.2079AlogP: 5.74#Rotatable Bonds: 3
Polar Surface Area: 109.42Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.58CX Basic pKa: 3.76CX LogP: 5.05CX LogD: 5.05
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: -0.77

References

1. Corte JR, Pinto DJP, Fang T, Osuna H, Yang W, Wang Y, Lai A, Clark CG, Sun JH, Rampulla R, Mathur A, Kaspady M, Neithnadka PR, Li YC, Rossi KA, Myers JE, Sheriff S, Lou Z, Harper TW, Huang C, Zheng JJ, Bozarth JM, Wu Y, Wong PC, Crain EJ, Seiffert DA, Luettgen JM, Lam PYS, Wexler RR, Ewing WR..  (2020)  Potent, Orally Bioavailable, and Efficacious Macrocyclic Inhibitors of Factor XIa. Discovery of Pyridine-Based Macrocycles Possessing Phenylazole Carboxamide P1 Groups.,  63  (2): [PMID:31833761] [10.1021/acs.jmedchem.9b01768]

Source