5-amino-1-[4-chloro-3-(methyloxy)phenyl]-3-(1,1-dimethylethyl)-1H-pyrazole-4-carboxamide

ID: ALA4585896

PubChem CID: 155566917

Max Phase: Preclinical

Molecular Formula: C15H19ClN4O2

Molecular Weight: 322.80

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(-n2nc(C(C)(C)C)c(C(N)=O)c2N)ccc1Cl

Standard InChI:  InChI=1S/C15H19ClN4O2/c1-15(2,3)12-11(14(18)21)13(17)20(19-12)8-5-6-9(16)10(7-8)22-4/h5-7H,17H2,1-4H3,(H2,18,21)

Standard InChI Key:  IWYMFXXUCNFTEW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   23.0950  -13.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7648  -13.6954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4183  -13.2045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1511  -12.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3349  -12.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3222  -13.4930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8423  -11.7953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1606  -11.0427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0313  -11.8960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6182  -11.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4324  -11.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2711  -11.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0193  -11.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7781  -14.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0759  -14.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0896  -15.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8047  -16.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5076  -15.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4905  -14.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2236  -16.1114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2405  -16.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8198  -16.9597    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  7  9  1  0
  4 10  1  0
 10 11  1  0
 10 12  1  0
 10 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  2 14  1  0
 18 20  1  0
 20 21  1  0
 17 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4585896

    ---

Associated Targets(Human)

RIPK2 Tchem Serine/threonine-protein kinase RIPK2 (1546 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.80Molecular Weight (Monoisotopic): 322.1197AlogP: 2.51#Rotatable Bonds: 3
Polar Surface Area: 96.16Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.21CX Basic pKa: 2.74CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.91Np Likeness Score: -1.60

References

1. Haffner CD, Charnley AK, Aquino CJ, Casillas L, Convery MA, Cox JA, Elban MA, Goodwin NC, Gough PJ, Haile PA, Hughes TV, Knapp-Reed B, Kreatsoulas C, Lakdawala AS, Li H, Lian Y, Lipshutz D, Mehlmann JF, Ouellette M, Romano J, Shewchuk L, Shu A, Votta BJ, Zhou H, Bertin J, Marquis RW..  (2019)  Discovery of Pyrazolocarboxamides as Potent and Selective Receptor Interacting Protein 2 (RIP2) Kinase Inhibitors.,  10  (11): [PMID:31749904] [10.1021/acsmedchemlett.9b00141]

Source