6,7-Dimethoxy-2-((4'-(3-((4-methoxy-1,2,5-oxadiazol-3-yl)oxy)-ethoxy)biphen-4-yl)methyl)-1,2,3,4-tetrahydroisoquinoline

ID: ALA4585968

PubChem CID: 155566986

Max Phase: Preclinical

Molecular Formula: C29H31N3O6

Molecular Weight: 517.58

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCOc4nonc4OC)cc3)cc1)CC2

Standard InChI:  InChI=1S/C29H31N3O6/c1-33-26-16-23-12-13-32(19-24(23)17-27(26)34-2)18-20-4-6-21(7-5-20)22-8-10-25(11-9-22)36-14-15-37-29-28(35-3)30-38-31-29/h4-11,16-17H,12-15,18-19H2,1-3H3

Standard InChI Key:  PJOQAKOMOGXSFR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    2.6359   -4.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6347   -5.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3428   -6.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3410   -4.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0496   -4.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0530   -5.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7654   -6.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4789   -5.7436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4756   -4.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7586   -4.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1878   -6.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8943   -5.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5993   -6.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3054   -5.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3036   -4.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5898   -4.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8866   -4.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0062   -4.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7158   -4.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4214   -4.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4185   -3.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7042   -3.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0015   -3.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1240   -3.2759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8339   -3.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9267   -6.1554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2193   -5.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9281   -4.5194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2205   -4.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5394   -3.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2493   -3.6731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9548   -3.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7007   -3.5927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2442   -2.9825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8318   -2.2770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0334   -2.4513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4225   -1.9085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5870   -1.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
 21 24  1  0
 24 25  1  0
  2 26  1  0
 26 27  1  0
  1 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 32  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4585968

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 517.58

Molecular Weight (Monoisotopic): 517.2213

AlogP: 4.78

#Rotatable Bonds: 11

Polar Surface Area: 88.31

Molecular Species: NEUTRAL

HBA: 9

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: 7.70

CX LogP: 5.12

CX LogD: 4.64

Aromatic Rings: 4

Heavy Atoms: 38

QED Weighted: 0.26

Np Likeness Score: -0.88

References

1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A..  (2016)  Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein.,  59  (14): [PMID:27336199] [10.1021/acs.jmedchem.6b00252]

2. Mancini RS, Barden CJ, Weaver DF, Reed MA..  (2021)  Furazans in Medicinal Chemistry.,  64  (4.0): [PMID:33569941] [10.1021/acs.jmedchem.0c01901]

Source

Source(1):

• Scientific Literature