1,4-dihydroxy-2-(hydroxy(4-(methylthio)phenyl)methyl)anthracene-9,10-dione

ID: ALA4586039

PubChem CID: 155566929

Max Phase: Preclinical

Molecular Formula: C22H16O5S

Molecular Weight: 392.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSc1ccc(C(O)c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)cc1

Standard InChI:  InChI=1S/C22H16O5S/c1-28-12-8-6-11(7-9-12)19(24)15-10-16(23)17-18(22(15)27)21(26)14-5-3-2-4-13(14)20(17)25/h2-10,19,23-24,27H,1H3

Standard InChI Key:  MTRAKVLZHXDCLK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    5.3071  -17.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3071  -16.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6019  -17.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6044  -16.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9007  -16.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1939  -16.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1953  -17.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8996  -17.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0124  -16.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0108  -17.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7150  -17.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4213  -17.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4190  -16.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7142  -16.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3057  -15.2749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3083  -18.5436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7144  -18.5446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7122  -15.2812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1254  -16.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1228  -15.2740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8309  -16.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8321  -17.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5403  -17.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2477  -17.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2424  -16.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5337  -16.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9572  -17.7155    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.9609  -18.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 24 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4586039

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.43Molecular Weight (Monoisotopic): 392.0718AlogP: 3.68#Rotatable Bonds: 3
Polar Surface Area: 94.83Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.49CX Basic pKa: CX LogP: 5.26CX LogD: 5.22
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: 0.49

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source