The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(furan-2-ylmethyl)-2-(6-morpholino-4-oxo-3-phenethyl-3,4-dihydroquinazolin-2-ylthio)acetamide ID: ALA4586347
Cas Number: 896683-78-6
PubChem CID: 3293286
Max Phase: Preclinical
Molecular Formula: C27H28N4O4S
Molecular Weight: 504.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc2ccc(N3CCOCC3)cc2c(=O)n1CCc1ccccc1)NCc1ccco1
Standard InChI: InChI=1S/C27H28N4O4S/c32-25(28-18-22-7-4-14-35-22)19-36-27-29-24-9-8-21(30-12-15-34-16-13-30)17-23(24)26(33)31(27)11-10-20-5-2-1-3-6-20/h1-9,14,17H,10-13,15-16,18-19H2,(H,28,32)
Standard InChI Key: HBAWGWWMULJGHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
11.6910 -19.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6899 -20.3702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3979 -20.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3961 -19.1418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1048 -19.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1055 -20.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8140 -20.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5223 -20.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5176 -19.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8085 -19.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9818 -20.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9812 -21.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2732 -22.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5675 -21.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8600 -21.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8589 -22.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5712 -23.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2759 -22.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9832 -19.1422 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.2756 -19.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5678 -19.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8602 -19.5513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5676 -18.3254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1524 -19.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4448 -19.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7012 -19.2220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1545 -19.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5633 -20.5371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3625 -20.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3998 -21.5963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2316 -20.7681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2305 -21.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9357 -21.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6442 -21.5797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6430 -20.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9333 -20.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
1 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 2 0
3 30 2 0
8 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.61Molecular Weight (Monoisotopic): 504.1831AlogP: 3.48#Rotatable Bonds: 9Polar Surface Area: 89.60Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.68CX Basic pKa: 5.32CX LogP: 3.64CX LogD: 3.64Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -2.15
References 1. Schauer NJ, Magin RS, Liu X, Doherty LM, Buhrlage SJ.. (2020) Advances in Discovering Deubiquitinating Enzyme (DUB) Inhibitors., 63 (6): [PMID:31682427 ] [10.1021/acs.jmedchem.9b01138 ] 2. Perez, Christian C and 8 more authors. 2017-02-23 Discovery of an Inhibitor of the Proteasome Subunit Rpn11. [PMID:28191850 ]