N-(furan-2-ylmethyl)-2-(6-morpholino-4-oxo-3-phenethyl-3,4-dihydroquinazolin-2-ylthio)acetamide

ID: ALA4586347

Cas Number: 896683-78-6

PubChem CID: 3293286

Max Phase: Preclinical

Molecular Formula: C27H28N4O4S

Molecular Weight: 504.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CSc1nc2ccc(N3CCOCC3)cc2c(=O)n1CCc1ccccc1)NCc1ccco1

Standard InChI:  InChI=1S/C27H28N4O4S/c32-25(28-18-22-7-4-14-35-22)19-36-27-29-24-9-8-21(30-12-15-34-16-13-30)17-23(24)26(33)31(27)11-10-20-5-2-1-3-6-20/h1-9,14,17H,10-13,15-16,18-19H2,(H,28,32)

Standard InChI Key:  HBAWGWWMULJGHR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   11.6910  -19.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6899  -20.3702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3979  -20.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3961  -19.1418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1048  -19.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1055  -20.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8140  -20.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5223  -20.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5176  -19.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8085  -19.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9818  -20.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9812  -21.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2732  -22.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5675  -21.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8600  -21.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8589  -22.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5712  -23.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2759  -22.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9832  -19.1422    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.2756  -19.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5678  -19.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8602  -19.5513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5676  -18.3254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1524  -19.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4448  -19.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7012  -19.2220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1545  -19.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5633  -20.5371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3625  -20.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3998  -21.5963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2316  -20.7681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2305  -21.5818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9357  -21.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6442  -21.5797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6430  -20.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9333  -20.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  2  0
  3 30  2  0
  8 31  1  0
 31 32  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4586347

    Stambp-IN-1

Associated Targets(Human)

STAMBP Tchem STAM-binding protein (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 504.61Molecular Weight (Monoisotopic): 504.1831AlogP: 3.48#Rotatable Bonds: 9
Polar Surface Area: 89.60Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.68CX Basic pKa: 5.32CX LogP: 3.64CX LogD: 3.64
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -2.15

References

1. Schauer NJ, Magin RS, Liu X, Doherty LM, Buhrlage SJ..  (2020)  Advances in Discovering Deubiquitinating Enzyme (DUB) Inhibitors.,  63  (6): [PMID:31682427] [10.1021/acs.jmedchem.9b01138]
2. Perez, Christian C and 8 more authors.  2017-02-23  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.  [PMID:28191850]

Source