N-(3,4-dichlorophenethyl)-2-((5-methoxy-7-methyl-1H-indol-3-yl)methylene)hydrazinecarboximidamide

ID: ALA4586446

PubChem CID: 155566939

Max Phase: Preclinical

Molecular Formula: C20H21Cl2N5O

Molecular Weight: 418.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C)c2[nH]cc(/C=N/NC(=N)NCCc3ccc(Cl)c(Cl)c3)c2c1

Standard InChI:  InChI=1S/C20H21Cl2N5O/c1-12-7-15(28-2)9-16-14(10-25-19(12)16)11-26-27-20(23)24-6-5-13-3-4-17(21)18(22)8-13/h3-4,7-11,25H,5-6H2,1-2H3,(H3,23,24,27)/b26-11+

Standard InChI Key:  JGIPHTRWXCTQHW-KBKYJPHKSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    3.9896   -5.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9885   -6.1436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6965   -6.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6947   -4.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4033   -5.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4081   -6.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1882   -6.3875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6655   -5.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1804   -5.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6976   -7.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2818   -4.9157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4284   -4.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2267   -4.1098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4747   -3.3311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2730   -3.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5209   -2.3779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8233   -3.7606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6217   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1720   -4.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9704   -4.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5167   -4.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3144   -4.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5630   -3.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0078   -3.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2123   -3.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2531   -2.2811    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.3611   -3.4904    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5742   -5.3244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  3 10  1  0
  1 11  1  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 24 26  1  0
 23 27  1  0
 11 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4586446

    ---

Associated Targets(Human)

RXFP3 Tchem Relaxin-3 receptor 1 (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RXFP4 Tchem Relaxin-3 receptor 2 (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.33Molecular Weight (Monoisotopic): 417.1123AlogP: 4.48#Rotatable Bonds: 6
Polar Surface Area: 85.29Molecular Species: NEUTRALHBA: 3HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.03CX LogP: 4.92CX LogD: 4.20
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.27Np Likeness Score: -0.78

References

1. DeChristopher B, Park SH, Vong L, Bamford D, Cho HH, Duvadie R, Fedolak A, Hogan C, Honda T, Pandey P, Rozhitskaya O, Su L, Tomlinson E, Wallace I..  (2019)  Discovery of a small molecule RXFP3/4 agonist that increases food intake in rats upon acute central administration.,  29  (8): [PMID:30824200] [10.1016/j.bmcl.2019.02.013]
2. Guan D, Rahman MT, Gay EA, Vasukuttan V, Mathews KM, Decker AM, Williams AH, Zhan CG, Jin C..  (2021)  Indole-Containing Amidinohydrazones as Nonpeptide, Dual RXFP3/4 Agonists: Synthesis, Structure-Activity Relationship, and Molecular Modeling Studies.,  64  (24.0): [PMID:34855388] [10.1021/acs.jmedchem.1c01081]

Source