Schwarzinicine A

ID: ALA4586939

PubChem CID: 155566732

Max Phase: Preclinical

Molecular Formula: C30H39NO6

Molecular Weight: 509.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCNC(CCc2ccc(OC)c(OC)c2)Cc2ccc(OC)c(OC)c2)cc1OC

Standard InChI:  InChI=1S/C30H39NO6/c1-32-25-12-8-21(18-28(25)35-4)7-11-24(17-23-10-14-27(34-3)30(20-23)37-6)31-16-15-22-9-13-26(33-2)29(19-22)36-5/h8-10,12-14,18-20,24,31H,7,11,15-17H2,1-6H3

Standard InChI Key:  DVTXGCNDTXJJFM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    3.8720   -7.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5800   -6.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2842   -7.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2842   -8.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5826   -8.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8720   -8.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1598   -8.5004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1598   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9964   -8.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7045   -8.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4125   -8.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1206   -8.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8328   -8.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5411   -8.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2456   -8.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2456   -9.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5436   -9.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8328   -9.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9578   -9.7262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6658   -9.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9578   -8.0869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9578   -7.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7045   -7.2680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4125   -6.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4125   -6.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1206   -5.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1209   -4.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8306   -4.4046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5390   -4.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5412   -5.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8330   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2471   -4.4048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2471   -3.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8306   -3.5852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1184   -3.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1598   -6.8609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4517   -7.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 15 21  1  0
 21 22  1  0
 10 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 32 33  1  0
 28 34  1  0
 34 35  1  0
  1 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4586939

    ---

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Aorta (2975 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.64Molecular Weight (Monoisotopic): 509.2777AlogP: 5.11#Rotatable Bonds: 15
Polar Surface Area: 67.41Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.48CX LogP: 5.40CX LogD: 2.55
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: 0.16

References

1. Krishnan P, Lee FK, Yap VA, Low YY, Kam TS, Yong KT, Ting KN, Lim KH..  (2020)  Schwarzinicines A-G, 1,4-Diarylbutanoid-Phenethylamine Conjugates from the Leaves of Ficus schwarzii.,  83  (1): [PMID:31935094] [10.1021/acs.jnatprod.9b01160]

Source