The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Schwarzinicine A ID: ALA4586939
PubChem CID: 155566732
Max Phase: Preclinical
Molecular Formula: C30H39NO6
Molecular Weight: 509.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCNC(CCc2ccc(OC)c(OC)c2)Cc2ccc(OC)c(OC)c2)cc1OC
Standard InChI: InChI=1S/C30H39NO6/c1-32-25-12-8-21(18-28(25)35-4)7-11-24(17-23-10-14-27(34-3)30(20-23)37-6)31-16-15-22-9-13-26(33-2)29(19-22)36-5/h8-10,12-14,18-20,24,31H,7,11,15-17H2,1-6H3
Standard InChI Key: DVTXGCNDTXJJFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
3.8720 -7.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5800 -6.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2842 -7.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2842 -8.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5826 -8.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8720 -8.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1598 -8.5004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1598 -9.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9964 -8.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7045 -8.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4125 -8.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1206 -8.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8328 -8.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5411 -8.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2456 -8.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2456 -9.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5436 -9.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8328 -9.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9578 -9.7262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6658 -9.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9578 -8.0869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9578 -7.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7045 -7.2680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4125 -6.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4125 -6.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1206 -5.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1209 -4.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8306 -4.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5390 -4.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5412 -5.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8330 -6.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2471 -4.4048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2471 -3.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8306 -3.5852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1184 -3.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1598 -6.8609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4517 -7.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
15 21 1 0
21 22 1 0
10 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
32 33 1 0
28 34 1 0
34 35 1 0
1 36 1 0
36 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.64Molecular Weight (Monoisotopic): 509.2777AlogP: 5.11#Rotatable Bonds: 15Polar Surface Area: 67.41Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.48CX LogP: 5.40CX LogD: 2.55Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: 0.16
References 1. Krishnan P, Lee FK, Yap VA, Low YY, Kam TS, Yong KT, Ting KN, Lim KH.. (2020) Schwarzinicines A-G, 1,4-Diarylbutanoid-Phenethylamine Conjugates from the Leaves of Ficus schwarzii., 83 (1): [PMID:31935094 ] [10.1021/acs.jnatprod.9b01160 ]