2-amino-N-{2-chloro-5-[2-({4-[(methylamino)methyl]piperidin-1-yl}methyl)thiazol-5-yl]phenyl}oxazole-4-carboxamide

ID: ALA4586958

PubChem CID: 146257785

Max Phase: Preclinical

Molecular Formula: C21H25ClN6O2S

Molecular Weight: 460.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNCC1CCN(Cc2ncc(-c3ccc(Cl)c(NC(=O)c4coc(N)n4)c3)s2)CC1

Standard InChI:  InChI=1S/C21H25ClN6O2S/c1-24-9-13-4-6-28(7-5-13)11-19-25-10-18(31-19)14-2-3-15(22)16(8-14)26-20(29)17-12-30-21(23)27-17/h2-3,8,10,12-13,24H,4-7,9,11H2,1H3,(H2,23,27)(H,26,29)

Standard InChI Key:  FATVSEIPDOFFLV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    9.1937   -8.8910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3381   -8.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4603   -7.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4735   -6.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4867   -7.4842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4998   -6.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5131   -7.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5263   -6.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5263   -5.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5131   -5.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4998   -5.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4867   -5.1444    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.5398   -7.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6083   -7.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3911   -7.8779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8062   -8.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6620   -8.6476    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.3913   -9.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5616   -9.9044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1467   -8.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3170   -8.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9021   -9.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3170  -10.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1468  -10.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0724   -9.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6575   -8.8909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8278   -8.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4735   -5.7293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3916   -7.0084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6087   -7.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4452   -7.7555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
 11 12  1  0
  8 13  1  0
 14 13  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 16 18  1  0
 18 19  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 19 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
  4 28  2  0
 29  3  1  0
 30 29  2  0
  1 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4586958

    ---

Associated Targets(Human)

PAICS Tchem Multifunctional protein ADE2 (310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.99Molecular Weight (Monoisotopic): 460.1448AlogP: 3.72#Rotatable Bonds: 7
Polar Surface Area: 109.31Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.86CX Basic pKa: 10.66CX LogP: 2.27CX LogD: -1.07
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.57

References

1.  (2018)  Oxazole derivatives for use in the treatment of cancer, 

Source