The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-N-{2-chloro-5-[2-({4-[(methylamino)methyl]piperidin-1-yl}methyl)thiazol-5-yl]phenyl}oxazole-4-carboxamide ID: ALA4586958
PubChem CID: 146257785
Max Phase: Preclinical
Molecular Formula: C21H25ClN6O2S
Molecular Weight: 460.99
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNCC1CCN(Cc2ncc(-c3ccc(Cl)c(NC(=O)c4coc(N)n4)c3)s2)CC1
Standard InChI: InChI=1S/C21H25ClN6O2S/c1-24-9-13-4-6-28(7-5-13)11-19-25-10-18(31-19)14-2-3-15(22)16(8-14)26-20(29)17-12-30-21(23)27-17/h2-3,8,10,12-13,24H,4-7,9,11H2,1H3,(H2,23,27)(H,26,29)
Standard InChI Key: FATVSEIPDOFFLV-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
9.1937 -8.8910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3381 -8.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4603 -7.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4735 -6.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4867 -7.4842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4998 -6.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5131 -7.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5263 -6.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5263 -5.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5131 -5.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4998 -5.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4867 -5.1444 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.5398 -7.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6083 -7.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3911 -7.8779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8062 -8.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6620 -8.6476 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.3913 -9.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5616 -9.9044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1467 -8.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3170 -8.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9021 -9.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3170 -10.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1468 -10.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0724 -9.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6575 -8.8909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8278 -8.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4735 -5.7293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3916 -7.0084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6087 -7.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4452 -7.7555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
11 12 1 0
8 13 1 0
14 13 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 1 0
20 19 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
19 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
4 28 2 0
29 3 1 0
30 29 2 0
1 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.99Molecular Weight (Monoisotopic): 460.1448AlogP: 3.72#Rotatable Bonds: 7Polar Surface Area: 109.31Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.86CX Basic pKa: 10.66CX LogP: 2.27CX LogD: -1.07Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.57
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,