3-amino-N-[2-[4-[(5S)-3,9-diazaspiro[4.5]decan-3-yl]phenyl]ethyl]-6-methyl-thieno[2,3-b]pyridine-2-carboxamide

ID: ALA4587235

PubChem CID: 155566514

Max Phase: Preclinical

Molecular Formula: C25H31N5OS

Molecular Weight: 449.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(N)c(C(=O)NCCc3ccc(N4CC[C@]5(CCCNC5)C4)cc3)sc2n1

Standard InChI:  InChI=1S/C25H31N5OS/c1-17-3-8-20-21(26)22(32-24(20)29-17)23(31)28-13-9-18-4-6-19(7-5-18)30-14-11-25(16-30)10-2-12-27-15-25/h3-8,27H,2,9-16,26H2,1H3,(H,28,31)/t25-/m0/s1

Standard InChI Key:  UBGTYXOXAHVQFB-VWLOTQADSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   11.9937  -12.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7820  -12.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3553  -11.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1458  -10.8627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3575  -10.6522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7787  -11.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0415  -11.8808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0397  -10.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7483  -10.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7536  -11.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5380  -11.7214    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0164  -11.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5295  -10.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7769   -9.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8336  -11.0512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2467  -11.7536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2376  -10.3393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0639  -11.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4770  -12.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2942  -12.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7012  -13.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5174  -13.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6894  -11.7450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5040  -11.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9238  -12.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7410  -12.4375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3335  -11.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3301  -10.6508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6265  -11.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2270  -13.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0022  -12.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2168  -11.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 27  7  1  0
  7 10  2  0
  9  8  2  0
  8 28  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 25  2  0
 24 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  1  0
 27 28  2  0
 27 29  1  0
 26 30  1  0
 30 31  1  0
 31  1  1  0
  1 32  1  1
 32 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4587235

    ---

Associated Targets(Human)

USP28 Tchem Ubiquitin carboxyl-terminal hydrolase 28 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
USP25 Tchem Ubiquitin carboxyl-terminal hydrolase 25 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.62Molecular Weight (Monoisotopic): 449.2249AlogP: 3.74#Rotatable Bonds: 5
Polar Surface Area: 83.28Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.07CX LogP: 3.44CX LogD: 0.87
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.29

References

1.  (2017)  Thienopyridine carboxamides as ubiquitin-specific protease inhibitors, 

Source