The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Benzyl ((S)-1-(((S)-1-(((S)-1-(3,4-dihydroisoquinolin-2(1H)-yl)-5-methyl-1,2-dioxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate ID: ALA4587250
PubChem CID: 155566550
Max Phase: Preclinical
Molecular Formula: C36H50N4O6
Molecular Weight: 634.82
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)N1CCc2ccccc2C1
Standard InChI: InChI=1S/C36H50N4O6/c1-23(2)18-29(32(41)35(44)40-17-16-27-14-10-11-15-28(27)21-40)37-33(42)30(19-24(3)4)38-34(43)31(20-25(5)6)39-36(45)46-22-26-12-8-7-9-13-26/h7-15,23-25,29-31H,16-22H2,1-6H3,(H,37,42)(H,38,43)(H,39,45)/t29-,30-,31-/m0/s1
Standard InChI Key: MXIQMKMLRNPBGN-CHQNGUEUSA-N
Molfile:
RDKit 2D
46 48 0 0 0 0 0 0 0 0999 V2000
4.8959 -22.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6103 -21.6876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1814 -21.6876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8959 -22.9251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1814 -20.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4669 -20.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4700 -19.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7563 -19.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0408 -19.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0435 -20.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7577 -20.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3248 -22.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0393 -21.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7537 -22.1001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0393 -20.8626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3248 -22.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0344 -23.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0346 -24.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7487 -22.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4682 -21.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1827 -22.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4682 -20.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1833 -20.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9012 -20.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1764 -19.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1827 -22.9251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8972 -21.6876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6117 -22.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3262 -21.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6117 -22.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3262 -20.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0406 -20.4501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6117 -20.4501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3262 -23.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3262 -24.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0406 -22.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0406 -22.1001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7494 -20.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7516 -19.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0331 -19.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4659 -19.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4600 -20.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1673 -20.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8809 -20.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8829 -19.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1750 -19.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
12 16 1 6
16 17 1 0
17 18 1 0
17 19 1 0
14 20 1 0
20 21 1 0
20 22 1 1
22 23 1 0
23 24 1 0
23 25 1 0
21 26 2 0
21 27 1 0
27 28 1 0
28 29 1 0
28 30 1 6
29 31 1 0
31 32 1 0
31 33 2 0
30 34 1 0
34 35 1 0
34 36 1 0
29 37 2 0
32 38 1 0
32 40 1 0
38 42 1 0
41 39 1 0
39 40 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 634.82Molecular Weight (Monoisotopic): 634.3730AlogP: 4.54#Rotatable Bonds: 15Polar Surface Area: 133.91Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.26CX Basic pKa: ┄CX LogP: 5.97CX LogD: 5.97Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.25Np Likeness Score: -0.42
References 1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M.. (2019) Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors., 10 (7): [PMID:31312413 ] [10.1021/acsmedchemlett.9b00233 ]