Brachangobinan C

ID: ALA4587287

PubChem CID: 54576103

Max Phase: Preclinical

Molecular Formula: C30H40O9

Molecular Weight: 544.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc([C@@H](O)[C@@H](COC(=O)CC(C)C)Oc2ccc(/C=C/COC(=O)CC(C)C)cc2OC)ccc1O

Standard InChI:  InChI=1S/C30H40O9/c1-19(2)14-28(32)37-13-7-8-21-9-12-24(26(16-21)36-6)39-27(18-38-29(33)15-20(3)4)30(34)22-10-11-23(31)25(17-22)35-5/h7-12,16-17,19-20,27,30-31,34H,13-15,18H2,1-6H3/b8-7+/t27-,30-/m1/s1

Standard InChI Key:  BNPCIGKUSXWQMX-FQTWUVKASA-N

Molfile:  

 
     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
    2.8464  -20.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8452  -21.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5533  -21.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2629  -21.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2601  -20.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5515  -20.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1386  -20.1451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5490  -19.3275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2555  -18.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9713  -21.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9726  -22.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6783  -21.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3867  -21.7779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6771  -20.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3841  -20.1435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0938  -21.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8008  -21.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5074  -21.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5066  -20.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7932  -20.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0896  -20.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8010  -22.5942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0934  -23.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2131  -20.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9220  -20.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6285  -20.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3374  -20.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3828  -19.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0899  -18.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6745  -18.9188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0886  -18.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7957  -17.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3803  -17.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0439  -20.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7528  -20.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0415  -19.3139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4593  -20.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1682  -20.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4569  -19.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  6  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  1  6
 10 12  1  0
 12 13  1  1
 12 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 15 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  0
 31 32  1  0
 31 33  1  0
 27 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
M  END

Associated Targets(non-human)

Trypanosoma congolense (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.64Molecular Weight (Monoisotopic): 544.2672AlogP: 5.08#Rotatable Bonds: 15
Polar Surface Area: 120.75Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.91CX Basic pKa: CX LogP: 5.25CX LogD: 5.25
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: 0.82

References

1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K..  (2019)  Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity.,  82  (4): [PMID:30896183] [10.1021/acs.jnatprod.8b00670]

Source