The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{3-[4-(5-methoxy-1H-indol-3-yl)piperidin-1-yl]propyl}-3-(5-fluoro-1H-indol-3-yl)pyrrolidine-2,5-dione ID: ALA4587314
PubChem CID: 155566396
Max Phase: Preclinical
Molecular Formula: C29H31FN4O3
Molecular Weight: 502.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2[nH]cc(C3CCN(CCCN4C(=O)CC(c5c[nH]c6ccc(F)cc56)C4=O)CC3)c2c1
Standard InChI: InChI=1S/C29H31FN4O3/c1-37-20-4-6-27-22(14-20)24(16-31-27)18-7-11-33(12-8-18)9-2-10-34-28(35)15-23(29(34)36)25-17-32-26-5-3-19(30)13-21(25)26/h3-6,13-14,16-18,23,31-32H,2,7-12,15H2,1H3
Standard InChI Key: USGQJDUNUQATFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
6.1731 -12.4849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9588 -12.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4316 -12.0544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9357 -11.3976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1589 -11.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1786 -10.6120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2528 -12.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6778 -12.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4990 -12.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9198 -13.4269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5202 -14.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9375 -14.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7550 -14.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1534 -14.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7344 -13.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1769 -15.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8547 -16.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4694 -16.8195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1683 -16.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9907 -15.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5857 -15.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3618 -15.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5439 -16.0903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9445 -16.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2290 -13.5006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5197 -12.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5340 -13.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7572 -14.0679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2613 -13.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7360 -12.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3906 -12.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5748 -11.9249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1056 -12.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4495 -13.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9606 -14.7365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7415 -14.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2312 -11.1835 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 2 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
10 15 1 0
13 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
20 19 2 0
20 16 1 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
2 25 2 0
1 26 1 0
27 26 2 0
28 27 1 0
29 28 1 0
29 30 2 0
26 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
22 35 1 0
35 36 1 0
32 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.59Molecular Weight (Monoisotopic): 502.2380AlogP: 4.91#Rotatable Bonds: 7Polar Surface Area: 81.43Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.02CX LogP: 3.44CX LogD: 1.81Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -0.81
References 1. Wróbel MZ, Chodkowski A, Herold F, Marciniak M, Dawidowski M, Siwek A, Starowicz G, Stachowicz K, Szewczyk B, Nowak G, Belka M, Bączek T, Satała G, Bojarski AJ, Turło J.. (2019) Synthesis and biological evaluation of new multi-target 3-(1H-indol-3-yl)pyrrolidine-2,5-dione derivatives with potential antidepressant effect., 183 [PMID:31586817 ] [10.1016/j.ejmech.2019.111736 ]