The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-phenyl-5-(1-phenyl-3-p-tolyl-1H-pyrazol-4-yl)-4,5-dihydro-1H-pyrazol-1-yl)propan-1-one ID: ALA4587380
PubChem CID: 155566372
Max Phase: Preclinical
Molecular Formula: C28H26N4O
Molecular Weight: 434.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N1N=C(c2ccccc2)CC1c1cn(-c2ccccc2)nc1-c1ccc(C)cc1
Standard InChI: InChI=1S/C28H26N4O/c1-3-27(33)32-26(18-25(29-32)21-10-6-4-7-11-21)24-19-31(23-12-8-5-9-13-23)30-28(24)22-16-14-20(2)15-17-22/h4-17,19,26H,3,18H2,1-2H3
Standard InChI Key: KGLIVBRXGXNYCS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
24.0501 -22.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8734 -22.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2822 -21.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8729 -20.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0464 -20.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6371 -21.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1106 -21.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5971 -22.3393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3822 -22.0858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3824 -21.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5974 -21.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0504 -22.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3439 -20.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8233 -19.5522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3408 -18.8838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5558 -19.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5558 -19.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9629 -23.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6262 -23.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3814 -23.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4653 -22.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8010 -22.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8875 -18.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6485 -19.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0645 -20.2650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0619 -18.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8870 -18.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8120 -21.6781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9757 -17.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3082 -17.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5529 -17.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4692 -18.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1377 -18.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 7 1 0
3 7 1 0
9 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
16 23 1 0
14 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
6 28 1 0
23 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2107AlogP: 5.94#Rotatable Bonds: 5Polar Surface Area: 50.49Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.78CX LogP: 6.23CX LogD: 6.23Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -1.52
References 1. Bekhit AA, El-Agroudy E, Helmy A, Ibrahim TM, Shavandi A, Bekhit AEA.. (2018) Leishmania treatment and prevention: Natural and synthesized drugs., 160 [PMID:30342363 ] [10.1016/j.ejmech.2018.10.022 ] 2. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V.. (2020) Recent advancements in the development of bioactive pyrazoline derivatives., 205 [PMID:32795767 ] [10.1016/j.ejmech.2020.112666 ]