The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5S)-N-[4-(4-Fluorophenoxy)phenyl]-5-(4-fluorophenyl)-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxamide ID: ALA4587440
PubChem CID: 155566723
Max Phase: Preclinical
Molecular Formula: C27H21F2N3O2
Molecular Weight: 457.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Oc2ccc(F)cc2)cc1)N1CCc2ncccc2[C@@H]1c1ccc(F)cc1
Standard InChI: InChI=1S/C27H21F2N3O2/c28-19-5-3-18(4-6-19)26-24-2-1-16-30-25(24)15-17-32(26)27(33)31-21-9-13-23(14-10-21)34-22-11-7-20(29)8-12-22/h1-14,16,26H,15,17H2,(H,31,33)/t26-/m0/s1
Standard InChI Key: AEOSDPHCSPJLGL-SANMLTNESA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
16.4456 -22.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4444 -23.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1525 -24.1387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1507 -22.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8593 -22.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8582 -23.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5644 -24.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2762 -23.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2774 -22.9086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5667 -22.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5667 -21.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2765 -21.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2769 -20.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5686 -20.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8586 -20.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8617 -21.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9861 -22.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6928 -22.9120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9881 -21.6845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4015 -22.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1038 -22.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8120 -22.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8145 -21.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1028 -21.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3975 -21.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5226 -21.2861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2299 -21.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2273 -22.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9337 -22.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6429 -22.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6411 -21.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9341 -21.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3507 -22.9208 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.5676 -19.2309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 6
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
14 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.48Molecular Weight (Monoisotopic): 457.1602AlogP: 6.33#Rotatable Bonds: 4Polar Surface Area: 54.46Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.79CX Basic pKa: 4.19CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.22
References 1. Wortmann L, Lindenthal B, Muhn P, Walter A, Nubbemeyer R, Heldmann D, Sobek L, Morandi F, Schrey AK, Moosmayer D, Günther J, Kuhnke J, Koppitz M, Lücking U, Röhn U, Schäfer M, Nowak-Reppel K, Kühne R, Weinmann H, Langer G.. (2019) Discovery of BAY-298 and BAY-899: Tetrahydro-1,6-naphthyridine-Based, Potent, and Selective Antagonists of the Luteinizing Hormone Receptor Which Reduce Sex Hormone Levels in Vivo., 62 (22): [PMID:31670515 ] [10.1021/acs.jmedchem.9b01382 ]