(5S)-N-[4-(4-Fluorophenoxy)phenyl]-5-(4-fluorophenyl)-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxamide

ID: ALA4587440

PubChem CID: 155566723

Max Phase: Preclinical

Molecular Formula: C27H21F2N3O2

Molecular Weight: 457.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccc(F)cc2)cc1)N1CCc2ncccc2[C@@H]1c1ccc(F)cc1

Standard InChI:  InChI=1S/C27H21F2N3O2/c28-19-5-3-18(4-6-19)26-24-2-1-16-30-25(24)15-17-32(26)27(33)31-21-9-13-23(14-10-21)34-22-11-7-20(29)8-12-22/h1-14,16,26H,15,17H2,(H,31,33)/t26-/m0/s1

Standard InChI Key:  AEOSDPHCSPJLGL-SANMLTNESA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   16.4456  -22.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4444  -23.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1525  -24.1387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1507  -22.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8593  -22.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8582  -23.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5644  -24.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2762  -23.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2774  -22.9086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5667  -22.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5667  -21.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2765  -21.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2769  -20.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5686  -20.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8586  -20.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8617  -21.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9861  -22.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6928  -22.9120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9881  -21.6845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4015  -22.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1038  -22.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8120  -22.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8145  -21.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1028  -21.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3975  -21.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5226  -21.2861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2299  -21.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2273  -22.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9337  -22.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6429  -22.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6411  -21.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9341  -21.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3507  -22.9208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.5676  -19.2309    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  6
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 14 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4587440

    ---

Associated Targets(Human)

LHCGR Tclin Luteinizing hormone/Choriogonadotropin receptor (373 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 457.48Molecular Weight (Monoisotopic): 457.1602AlogP: 6.33#Rotatable Bonds: 4
Polar Surface Area: 54.46Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.79CX Basic pKa: 4.19CX LogP: 5.47CX LogD: 5.47
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.22

References

1. Wortmann L, Lindenthal B, Muhn P, Walter A, Nubbemeyer R, Heldmann D, Sobek L, Morandi F, Schrey AK, Moosmayer D, Günther J, Kuhnke J, Koppitz M, Lücking U, Röhn U, Schäfer M, Nowak-Reppel K, Kühne R, Weinmann H, Langer G..  (2019)  Discovery of BAY-298 and BAY-899: Tetrahydro-1,6-naphthyridine-Based, Potent, and Selective Antagonists of the Luteinizing Hormone Receptor Which Reduce Sex Hormone Levels in Vivo.,  62  (22): [PMID:31670515] [10.1021/acs.jmedchem.9b01382]

Source