The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
18-(2-allylphenoxy)-1-amino-3,6,9,12-tetraoxa-15-azaoctadecan-17-ol ID: ALA4587648
PubChem CID: 155566405
Max Phase: Preclinical
Molecular Formula: C22H38N2O6
Molecular Weight: 426.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccccc1OCC(O)CNCCOCCOCCOCCOCCN
Standard InChI: InChI=1S/C22H38N2O6/c1-2-5-20-6-3-4-7-22(20)30-19-21(25)18-24-9-11-27-13-15-29-17-16-28-14-12-26-10-8-23/h2-4,6-7,21,24-25H,1,5,8-19,23H2
Standard InChI Key: JTICSMPQQVDYOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
26.9700 -1.9840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6729 -1.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3902 -1.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0964 -1.5398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8096 -1.9388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5158 -1.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2331 -1.9196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9394 -1.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6567 -1.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0225 -4.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0224 -3.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7300 -2.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4378 -3.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4366 -4.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1447 -4.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8543 -4.0358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8515 -3.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1429 -2.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1404 -1.9907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8469 -1.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5559 -1.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2623 -1.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5583 -2.8037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3578 -1.4805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0719 -1.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7730 -1.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4872 -1.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1882 -1.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9024 -1.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6035 -1.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
11 10 2 0
12 11 1 0
13 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 1 1 0
21 23 1 0
9 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.55Molecular Weight (Monoisotopic): 426.2730AlogP: 0.77#Rotatable Bonds: 21Polar Surface Area: 104.43Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.56CX LogP: 0.93CX LogD: -2.61Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.20Np Likeness Score: -0.26
References 1. Richardson PL, Marin VL, Koeniger SL, Baranczak A, Wilsbacher JL, Kovar PJ, Bacon-Trusk PE, Cheng M, Hopkins TA, Haman ST, Vasudevan A.. (2019) Controlling cellular distribution of drugs with permeability modifying moieties., 10 (6): [PMID:31303996 ] [10.1039/C8MD00412A ]