18-(2-allylphenoxy)-1-amino-3,6,9,12-tetraoxa-15-azaoctadecan-17-ol

ID: ALA4587648

PubChem CID: 155566405

Max Phase: Preclinical

Molecular Formula: C22H38N2O6

Molecular Weight: 426.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCc1ccccc1OCC(O)CNCCOCCOCCOCCOCCN

Standard InChI:  InChI=1S/C22H38N2O6/c1-2-5-20-6-3-4-7-22(20)30-19-21(25)18-24-9-11-27-13-15-29-17-16-28-14-12-26-10-8-23/h2-4,6-7,21,24-25H,1,5,8-19,23H2

Standard InChI Key:  JTICSMPQQVDYOJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 30  0  0  0  0  0  0  0  0999 V2000
   26.9700   -1.9840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6729   -1.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3902   -1.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0964   -1.5398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8096   -1.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5158   -1.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2331   -1.9196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9394   -1.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6567   -1.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0225   -4.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0224   -3.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7300   -2.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4378   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4366   -4.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1447   -4.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8543   -4.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8515   -3.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1429   -2.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1404   -1.9907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8469   -1.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5559   -1.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2623   -1.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5583   -2.8037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3578   -1.4805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0719   -1.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7730   -1.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4872   -1.8551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.1882   -1.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9024   -1.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6035   -1.4126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22  1  1  0
 21 23  1  0
  9 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4587648

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR1A Tclin Serotonin 1a (5-HT1a) receptor (14969 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.55Molecular Weight (Monoisotopic): 426.2730AlogP: 0.77#Rotatable Bonds: 21
Polar Surface Area: 104.43Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.56CX LogP: 0.93CX LogD: -2.61
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.20Np Likeness Score: -0.26

References

1. Richardson PL, Marin VL, Koeniger SL, Baranczak A, Wilsbacher JL, Kovar PJ, Bacon-Trusk PE, Cheng M, Hopkins TA, Haman ST, Vasudevan A..  (2019)  Controlling cellular distribution of drugs with permeability modifying moieties.,  10  (6): [PMID:31303996] [10.1039/C8MD00412A]

Source