(E)-3-amino-N-(4-(3-(4-hydroxy-3-methoxyphenyl)acrylamido)butyl)-5,7-dimethyladamantane-1-carboxamide

ID: ALA4587969

PubChem CID: 155567514

Max Phase: Preclinical

Molecular Formula: C27H39N3O4

Molecular Weight: 469.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)NCCCCNC(=O)C23CC4(C)CC(C)(CC(N)(C4)C2)C3)ccc1O

Standard InChI:  InChI=1S/C27H39N3O4/c1-24-13-25(2)15-26(14-24,18-27(28,16-24)17-25)23(33)30-11-5-4-10-29-22(32)9-7-19-6-8-20(31)21(12-19)34-3/h6-9,12,31H,4-5,10-11,13-18,28H2,1-3H3,(H,29,32)(H,30,33)/b9-7+

Standard InChI Key:  JYGOHPPFXGEMSX-VQHVLOKHSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   41.7480   -5.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3873   -4.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5489   -4.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0960   -4.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2986   -5.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8409   -4.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5463   -4.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1017   -3.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3828   -3.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8467   -3.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5653   -4.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5435   -5.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0965   -2.5506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1600   -3.7066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1535   -5.1302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.3387   -3.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9292   -2.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1079   -2.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7026   -2.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8813   -2.2679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4653   -2.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6440   -2.9740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8747   -3.6915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2321   -3.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4108   -3.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0039   -2.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1834   -2.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7707   -3.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1804   -4.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9996   -4.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9494   -3.6708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7784   -2.2491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9571   -2.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6575   -4.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
  2 11  1  0
  3 12  1  0
  8 13  1  0
 11 14  1  0
 11 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 27 32  1  0
 32 33  1  0
  6 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4587969

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate NMDA receptor; GRIN1/GRIN2A (719 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.63Molecular Weight (Monoisotopic): 469.2941AlogP: 3.50#Rotatable Bonds: 9
Polar Surface Area: 113.68Molecular Species: BASEHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.79CX Basic pKa: 10.57CX LogP: 1.68CX LogD: -0.19
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: 0.19

References

1. Rosini M, Simoni E, Caporaso R, Basagni F, Catanzaro M, Abu IF, Fagiani F, Fusco F, Masuzzo S, Albani D, Lanni C, Mellor IR, Minarini A..  (2019)  Merging memantine and ferulic acid to probe connections between NMDA receptors, oxidative stress and amyloid-β peptide in Alzheimer's disease.,  180  [PMID:31301562] [10.1016/j.ejmech.2019.07.011]

Source