The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-amino-N-(4-(3-(4-hydroxy-3-methoxyphenyl)acrylamido)butyl)-5,7-dimethyladamantane-1-carboxamide ID: ALA4587969
PubChem CID: 155567514
Max Phase: Preclinical
Molecular Formula: C27H39N3O4
Molecular Weight: 469.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)NCCCCNC(=O)C23CC4(C)CC(C)(CC(N)(C4)C2)C3)ccc1O
Standard InChI: InChI=1S/C27H39N3O4/c1-24-13-25(2)15-26(14-24,18-27(28,16-24)17-25)23(33)30-11-5-4-10-29-22(32)9-7-19-6-8-20(31)21(12-19)34-3/h6-9,12,31H,4-5,10-11,13-18,28H2,1-3H3,(H,29,32)(H,30,33)/b9-7+
Standard InChI Key: JYGOHPPFXGEMSX-VQHVLOKHSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
41.7480 -5.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3873 -4.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5489 -4.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0960 -4.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2986 -5.1782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8409 -4.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5463 -4.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1017 -3.3739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3828 -3.6279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8467 -3.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5653 -4.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5435 -5.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0965 -2.5506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1600 -3.7066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1535 -5.1302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3387 -3.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9292 -2.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1079 -2.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7026 -2.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8813 -2.2679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4653 -2.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6440 -2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8747 -3.6915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2321 -3.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4108 -3.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0039 -2.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1834 -2.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7707 -3.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1804 -4.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9996 -4.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9494 -3.6708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7784 -2.2491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9571 -2.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6575 -4.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
2 11 1 0
3 12 1 0
8 13 1 0
11 14 1 0
11 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
27 32 1 0
32 33 1 0
6 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.63Molecular Weight (Monoisotopic): 469.2941AlogP: 3.50#Rotatable Bonds: 9Polar Surface Area: 113.68Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.79CX Basic pKa: 10.57CX LogP: 1.68CX LogD: -0.19Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: 0.19
References 1. Rosini M, Simoni E, Caporaso R, Basagni F, Catanzaro M, Abu IF, Fagiani F, Fusco F, Masuzzo S, Albani D, Lanni C, Mellor IR, Minarini A.. (2019) Merging memantine and ferulic acid to probe connections between NMDA receptors, oxidative stress and amyloid-β peptide in Alzheimer's disease., 180 [PMID:31301562 ] [10.1016/j.ejmech.2019.07.011 ]