The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-3-(3-(4-(4-morpholinopiperidin-1-yl)phenyl)-1H-indazol-6-yl)-N-(3-(trifluoromethyl)phenyl)benzamide ID: ALA4587973
PubChem CID: 155567552
Max Phase: Preclinical
Molecular Formula: C37H36F3N5O2
Molecular Weight: 639.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1-c1ccc2c(-c3ccc(N4CCC(N5CCOCC5)CC4)cc3)n[nH]c2c1
Standard InChI: InChI=1S/C37H36F3N5O2/c1-24-5-6-27(36(46)41-29-4-2-3-28(23-29)37(38,39)40)21-33(24)26-9-12-32-34(22-26)42-43-35(32)25-7-10-30(11-8-25)44-15-13-31(14-16-44)45-17-19-47-20-18-45/h2-12,21-23,31H,13-20H2,1H3,(H,41,46)(H,42,43)
Standard InChI Key: OMCAPVOZCPLRRN-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 53 0 0 0 0 0 0 0 0999 V2000
33.3312 -1.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0409 -0.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0381 0.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3294 0.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7412 0.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4507 0.0394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1564 0.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1538 1.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4396 1.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7368 1.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0264 1.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8655 0.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8681 -0.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5718 0.4579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2809 0.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2800 -0.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9882 -1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6955 -0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6902 0.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9814 0.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6232 -0.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6244 0.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8482 0.2819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3672 -0.3805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8462 -1.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3976 0.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0390 0.8536 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.1979 0.1741 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.5282 1.3186 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.5951 -1.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7941 -1.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5404 -2.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0865 -3.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8897 -3.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1397 -2.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8374 -4.1431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0367 -4.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7833 -5.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3272 -5.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1279 -5.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3847 -4.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0753 -6.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2740 -6.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0177 -7.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5592 -8.0193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3605 -7.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6204 -7.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 22 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 5 1 0
10 11 1 0
7 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
26 27 1 0
26 28 1 0
26 29 1 0
19 26 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
25 30 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
33 36 1 0
42 43 1 0
42 47 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 639.72Molecular Weight (Monoisotopic): 639.2821AlogP: 7.78#Rotatable Bonds: 6Polar Surface Area: 73.49Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.87CX Basic pKa: 7.69CX LogP: 7.38CX LogD: 6.91Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.20Np Likeness Score: -1.53
References 1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B.. (2019) Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma., 163 [PMID:30572178 ] [10.1016/j.ejmech.2018.12.015 ]