The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-dehydroxy-epoxyphomalin A ID: ALA4588050
PubChem CID: 132561492
Max Phase: Preclinical
Molecular Formula: C22H32O4
Molecular Weight: 360.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@]12O[C@@H]1C(=O)C(CO)=C[C@H]2O
Standard InChI: InChI=1S/C22H32O4/c1-13-6-7-16-20(2,3)8-5-9-21(16,4)15(13)11-22-17(24)10-14(12-23)18(25)19(22)26-22/h6,10,15-17,19,23-24H,5,7-9,11-12H2,1-4H3/t15-,16-,17+,19+,21+,22-/m0/s1
Standard InChI Key: CVIHRYGKKDVPRR-FZQGVADYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
41.2798 -3.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2798 -4.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9924 -5.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9924 -3.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7050 -3.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7015 -4.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4109 -5.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1283 -4.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1317 -3.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4178 -3.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4202 -2.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1364 -2.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8448 -3.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6977 -3.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9933 -5.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2715 -5.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6936 -5.5401 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
45.3696 -1.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9614 -0.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1364 -0.8203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7196 -1.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9614 -2.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5469 -2.9621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8946 -1.5371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.3729 -0.1058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1979 -0.1070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.1947 -1.5371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.5418 -2.8316 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 1
11 12 1 0
9 13 1 0
5 14 1 1
3 15 1 0
3 16 1 0
6 17 1 6
12 21 1 0
22 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
12 22 1 0
12 23 1 1
22 23 1 0
21 24 1 6
19 25 1 0
25 26 1 0
18 27 2 0
22 28 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 360.49Molecular Weight (Monoisotopic): 360.2301AlogP: 3.18#Rotatable Bonds: 3Polar Surface Area: 70.06Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.43CX Basic pKa: ┄CX LogP: 3.07CX LogD: 3.07Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: 3.45