11-dehydroxy-epoxyphomalin A

ID: ALA4588050

PubChem CID: 132561492

Max Phase: Preclinical

Molecular Formula: C22H32O4

Molecular Weight: 360.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@]12O[C@@H]1C(=O)C(CO)=C[C@H]2O

Standard InChI:  InChI=1S/C22H32O4/c1-13-6-7-16-20(2,3)8-5-9-21(16,4)15(13)11-22-17(24)10-14(12-23)18(25)19(22)26-22/h6,10,15-17,19,23-24H,5,7-9,11-12H2,1-4H3/t15-,16-,17+,19+,21+,22-/m0/s1

Standard InChI Key:  CVIHRYGKKDVPRR-FZQGVADYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   41.2798   -3.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2798   -4.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9924   -5.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9924   -3.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7050   -3.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7015   -4.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4109   -5.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1283   -4.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1317   -3.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4178   -3.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4202   -2.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1364   -2.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8448   -3.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6977   -3.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9933   -5.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2715   -5.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6936   -5.5401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   45.3696   -1.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9614   -0.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1364   -0.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7196   -1.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9614   -2.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5469   -2.9621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8946   -1.5371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.3729   -0.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1979   -0.1070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.1947   -1.5371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.5418   -2.8316    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  1
 11 12  1  0
  9 13  1  0
  5 14  1  1
  3 15  1  0
  3 16  1  0
  6 17  1  6
 12 21  1  0
 22 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 12 22  1  0
 12 23  1  1
 22 23  1  0
 21 24  1  6
 19 25  1  0
 25 26  1  0
 18 27  2  0
 22 28  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4588050

    ---

Associated Targets(Human)

OVCAR-3 (48710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.49Molecular Weight (Monoisotopic): 360.2301AlogP: 3.18#Rotatable Bonds: 3
Polar Surface Area: 70.06Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.43CX Basic pKa: CX LogP: 3.07CX LogD: 3.07
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: 3.45

References

1. Li SJ, Zhang X, Wang XH, Zhao CQ..  (2018)  Novel natural compounds from endophytic fungi with anticancer activity.,  156  [PMID:30015071] [10.1016/j.ejmech.2018.07.015]

Source