2-(3-chloro-4-(4-(2-methoxyphenyl)-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-ylamino)phenyl)acetamide

ID: ALA4588067

PubChem CID: 155568192

Max Phase: Preclinical

Molecular Formula: C22H21ClN4O2

Molecular Weight: 408.89

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1-c1nnc(Nc2ccc(CC(N)=O)cc2Cl)c2c1CCC2

Standard InChI:  InChI=1S/C22H21ClN4O2/c1-29-19-8-3-2-5-16(19)21-14-6-4-7-15(14)22(27-26-21)25-18-10-9-13(11-17(18)23)12-20(24)28/h2-3,5,8-11H,4,6-7,12H2,1H3,(H2,24,28)(H,25,27)

Standard InChI Key:  SFYKZPDOOAGABG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   34.4624   -8.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6391   -5.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3487   -5.3053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3459   -4.4827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6373   -4.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9310   -5.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9322   -4.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1560   -4.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6751   -4.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1541   -5.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6321   -3.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3396   -2.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3361   -2.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6260   -1.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9179   -2.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9248   -2.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0487   -3.2603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7550   -2.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6389   -6.5320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3465   -6.9407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3421   -7.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0489   -8.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7577   -7.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7553   -6.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0479   -6.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1731   -7.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8813   -8.1626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1722   -6.9376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6332   -8.1626    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 11  1  0
 12 17  1  0
 17 18  1  0
  2 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23  1  1  0
  1 26  1  0
 26 27  1  0
 26 28  2  0
 21 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4588067

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.89Molecular Weight (Monoisotopic): 408.1353AlogP: 4.07#Rotatable Bonds: 6
Polar Surface Area: 90.13Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.59CX Basic pKa: 3.07CX LogP: 4.13CX LogD: 4.13
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.64Np Likeness Score: -1.10

References

1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y..  (2019)  Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators.,  29  (14): [PMID:31101471] [10.1016/j.bmcl.2019.05.013]

Source