The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3,4-dimethoxybenzyl)-1-(2-((1,3-dimethyl-1H-pyrazol-4-yl)amino)pyridin-4-yl)piperidine-3-carboxamide ID: ALA4588373
PubChem CID: 141488412
Max Phase: Preclinical
Molecular Formula: C25H32N6O3
Molecular Weight: 464.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)[C@H]2CCCN(c3ccnc(Nc4cn(C)nc4C)c3)C2)cc1OC
Standard InChI: InChI=1S/C25H32N6O3/c1-17-21(16-30(2)29-17)28-24-13-20(9-10-26-24)31-11-5-6-19(15-31)25(32)27-14-18-7-8-22(33-3)23(12-18)34-4/h7-10,12-13,16,19H,5-6,11,14-15H2,1-4H3,(H,26,28)(H,27,32)/t19-/m0/s1
Standard InChI Key: AGDOAIWAELUOQM-IBGZPJMESA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
35.1475 -10.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1475 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8569 -12.1010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5663 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5663 -10.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8569 -10.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8564 -12.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1430 -13.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1426 -14.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8550 -14.5636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5692 -14.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5660 -13.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2793 -10.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9900 -10.8753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2817 -9.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7030 -10.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4136 -10.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4099 -11.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1156 -12.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8296 -11.7058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8293 -10.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1190 -10.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4306 -14.5624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7223 -14.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6334 -13.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8338 -13.1769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4262 -13.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9739 -14.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8062 -15.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5004 -12.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5363 -10.4703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.2448 -10.8776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5370 -12.1148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.5364 -12.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
28 29 1 0
26 30 1 0
21 31 1 0
31 32 1 0
20 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.57Molecular Weight (Monoisotopic): 464.2536AlogP: 3.42#Rotatable Bonds: 8Polar Surface Area: 93.54Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.73CX Basic pKa: 8.56CX LogP: 2.51CX LogD: 1.49Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -1.54
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]