The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-(R)-3-(3,4-dimethoxyphenyl)-1-(3-(2-morpholinoethoxy)phenyl)propyl 1-((1R,4aR,8aR)-4-oxodecahydronaphthalene-1-carbonyl)piperidine-2-carboxylate ID: ALA4588417
PubChem CID: 145707024
Max Phase: Preclinical
Molecular Formula: C40H54N2O8
Molecular Weight: 690.88
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC[C@@H](OC(=O)[C@@H]2CCCCN2C(=O)[C@@H]2CCC(=O)[C@@H]3CCCC[C@H]32)c2cccc(OCCN3CCOCC3)c2)cc1OC
Standard InChI: InChI=1S/C40H54N2O8/c1-46-37-18-14-28(26-38(37)47-2)13-17-36(29-8-7-9-30(27-29)49-25-22-41-20-23-48-24-21-41)50-40(45)34-12-5-6-19-42(34)39(44)33-15-16-35(43)32-11-4-3-10-31(32)33/h7-9,14,18,26-27,31-34,36H,3-6,10-13,15-17,19-25H2,1-2H3/t31-,32-,33-,34+,36-/m1/s1
Standard InChI Key: UGIVXHVIZXJHDG-YGYPXORBSA-N
Molfile:
RDKit 2D
52 57 0 0 0 0 0 0 0 0999 V2000
30.2140 -14.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2129 -15.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9250 -15.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6388 -15.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6360 -14.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9233 -14.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3513 -15.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3526 -16.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0651 -16.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0664 -17.7508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7763 -16.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4824 -16.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1931 -16.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1922 -15.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4748 -15.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7711 -15.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3552 -18.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6427 -17.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3564 -18.9860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6470 -16.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9386 -16.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2250 -16.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2243 -17.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9373 -18.1699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5007 -15.7017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7892 -15.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5021 -14.0575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5019 -13.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9054 -16.9269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6168 -16.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3290 -16.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0404 -16.5160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9395 -18.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6525 -19.3979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2288 -19.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5179 -18.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8093 -19.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8074 -20.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2349 -20.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5246 -20.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5253 -21.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2347 -21.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9451 -21.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9460 -20.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9418 -19.8107 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.8081 -21.0406 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.7495 -16.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4587 -16.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4642 -15.7069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7541 -15.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0386 -15.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0994 -20.6350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 6
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
10 17 1 0
18 17 1 1
17 19 2 0
18 20 1 0
18 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
2 25 1 0
25 26 1 0
1 27 1 0
27 28 1 0
13 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
24 33 1 0
33 34 2 0
35 33 1 1
35 36 1 0
35 39 1 0
36 37 1 0
37 38 1 0
38 40 1 0
39 40 1 0
39 44 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
39 45 1 1
40 46 1 6
32 47 1 0
32 51 1 0
47 48 1 0
48 49 1 0
49 50 1 0
50 51 1 0
38 52 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 690.88Molecular Weight (Monoisotopic): 690.3880AlogP: 5.80#Rotatable Bonds: 13Polar Surface Area: 103.84Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.64CX LogP: 5.86CX LogD: 5.79Aromatic Rings: 2Heavy Atoms: 50QED Weighted: 0.24Np Likeness Score: -0.26
References 1. Feng X, Sippel C, Knaup FH, Bracher A, Staibano S, Romano MF, Hausch F.. (2020) A Novel Decalin-Based Bicyclic Scaffold for FKBP51-Selective Ligands., 63 (1): [PMID:31800244 ] [10.1021/acs.jmedchem.9b01157 ]