1-Benzyl-2-imino-10-methyl-N-(3-morpholinopropyl)-5-oxo-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4588551

PubChem CID: 155567400

Max Phase: Preclinical

Molecular Formula: C27H30N6O3

Molecular Weight: 486.58

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn2c(=O)c3cc(C(=O)NCCCN4CCOCC4)c(=N)n(Cc4ccccc4)c3nc12

Standard InChI:  InChI=1S/C27H30N6O3/c1-19-7-5-12-32-24(19)30-25-22(27(32)35)17-21(23(28)33(25)18-20-8-3-2-4-9-20)26(34)29-10-6-11-31-13-15-36-16-14-31/h2-5,7-9,12,17,28H,6,10-11,13-16,18H2,1H3,(H,29,34)

Standard InChI Key:  KEUQLQKVVOPWIC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   14.3999  -15.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3999  -16.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1052  -16.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1052  -15.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8105  -15.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8115  -16.5708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5076  -16.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5055  -15.3419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2226  -15.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2229  -16.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9285  -16.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6384  -16.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6381  -15.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9279  -15.3397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1052  -14.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5068  -17.7935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3461  -15.3432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3457  -16.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3448  -17.7970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0538  -16.5719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7611  -16.9813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4692  -16.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1765  -16.9827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8846  -16.5749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5900  -16.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2961  -16.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3011  -15.7676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5940  -15.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8818  -15.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9265  -14.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6335  -14.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3420  -14.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0485  -14.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0460  -13.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3310  -12.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6275  -13.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  4 15  1  0
  7 16  2  0
 13 17  2  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 14 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4588551

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.58Molecular Weight (Monoisotopic): 486.2379AlogP: 1.94#Rotatable Bonds: 7
Polar Surface Area: 104.72Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.22CX LogP: 1.41CX LogD: 1.17
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.63

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source