The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((4'-((6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)-methyl)biphenyl-4-yl)oxy)ethoxy)-1,2,5-oxadiazol-3-carbonitrile ID: ALA4588731
PubChem CID: 155567530
Max Phase: Preclinical
Molecular Formula: C29H28N4O5
Molecular Weight: 512.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCOc4nonc4C#N)cc3)cc1)CC2
Standard InChI: InChI=1S/C29H28N4O5/c1-34-27-15-23-11-12-33(19-24(23)16-28(27)35-2)18-20-3-5-21(6-4-20)22-7-9-25(10-8-22)36-13-14-37-29-26(17-30)31-38-32-29/h3-10,15-16H,11-14,18-19H2,1-2H3
Standard InChI Key: JZQVLZHXVLSOOU-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
22.1948 -9.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1937 -10.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9017 -10.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8999 -9.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6085 -9.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6119 -10.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3243 -10.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0379 -10.2340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0345 -9.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3175 -8.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7467 -10.6407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4533 -10.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1582 -10.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8643 -10.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8625 -9.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1487 -9.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4455 -9.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5651 -9.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2747 -9.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9803 -8.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9774 -8.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2631 -7.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5605 -8.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6829 -7.7663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3928 -8.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4856 -10.6459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7783 -10.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4870 -9.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7794 -9.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0983 -7.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8082 -8.1635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5137 -7.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2596 -8.0832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8031 -7.4729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3907 -6.7674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5924 -6.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9807 -6.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3698 -5.8582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
21 24 1 0
24 25 1 0
2 26 1 0
26 27 1 0
1 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 36 2 0
36 32 1 0
37 38 3 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.57Molecular Weight (Monoisotopic): 512.2060AlogP: 4.64#Rotatable Bonds: 10Polar Surface Area: 102.87Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 4.92CX LogD: 4.45Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -1.07
References 1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A.. (2016) Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein., 59 (14): [PMID:27336199 ] [10.1021/acs.jmedchem.6b00252 ]