The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,15-Di((3-carboxypropoxyl)phenyl)porphin ID: ALA4588761
PubChem CID: 155567254
Max Phase: Preclinical
Molecular Formula: C40H34N4O6
Molecular Weight: 666.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCCOc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(OCCCC(=O)O)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1
Standard InChI: InChI=1S/C40H34N4O6/c45-37(46)9-3-19-49-31-7-1-5-25(21-31)39-33-15-11-27(41-33)23-29-13-17-35(43-29)40(26-6-2-8-32(22-26)50-20-4-10-38(47)48)36-18-14-30(44-36)24-28-12-16-34(39)42-28/h1-2,5-8,11-18,21-24,41,44H,3-4,9-10,19-20H2,(H,45,46)(H,47,48)/b27-23-,28-24-,29-23-,30-24-,39-33-,39-34-,40-35-,40-36-
Standard InChI Key: OVDORZKHSOGVER-OXMALSCHSA-N
Molfile:
RDKit 2D
50 56 0 0 0 0 0 0 0 0999 V2000
13.4247 -2.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4236 -3.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1234 -3.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8248 -3.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8220 -2.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1216 -2.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2841 -9.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2830 -10.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9828 -10.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6883 -10.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6855 -9.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9810 -9.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4368 -5.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2619 -5.7414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4183 -4.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6893 -4.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0582 -4.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1302 -4.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8357 -4.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9067 -5.7490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7464 -5.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1866 -5.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6625 -4.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0761 -6.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7098 -7.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8851 -7.4189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7103 -8.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4533 -8.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0279 -8.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9860 -8.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2996 -8.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2329 -7.2818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3977 -7.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9602 -7.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4909 -8.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0739 -6.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5282 -2.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2374 -2.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9436 -2.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5748 -10.9675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8676 -10.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1594 -10.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6528 -2.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3591 -2.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0682 -2.5213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3562 -1.2980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4522 -10.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7440 -10.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0367 -10.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7430 -11.7815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 2 0
21 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 25 1 0
27 30 1 0
30 31 2 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 31 1 0
33 36 2 0
36 13 1 0
18 3 1 0
30 12 1 0
5 37 1 0
37 38 1 0
38 39 1 0
8 40 1 0
40 41 1 0
41 42 1 0
39 43 1 0
43 44 1 0
44 45 1 0
44 46 2 0
42 47 1 0
47 48 1 0
48 49 1 0
48 50 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 666.73Molecular Weight (Monoisotopic): 666.2478AlogP: 8.48#Rotatable Bonds: 12Polar Surface Area: 150.42Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.39CX Basic pKa: 5.30CX LogP: 6.32CX LogD: 2.33Aromatic Rings: 5Heavy Atoms: 50QED Weighted: 0.09Np Likeness Score: 0.01
References 1. Zhu W, Gao YH, Liao PY, Chen DY, Sun NN, Nguyen Thi PA, Yan YJ, Wu XF, Chen ZL.. (2018) Comparison between porphin, chlorin and bacteriochlorin derivatives for photodynamic therapy: Synthesis, photophysical properties, and biological activity., 160 [PMID:30336449 ] [10.1016/j.ejmech.2018.10.005 ]