The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-cyclopentyl-N,N-dimethyl-2-(4-(piperazin-1-yl)phenylamino)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide ID: ALA4589103
PubChem CID: 58015961
Max Phase: Preclinical
Molecular Formula: C24H31N7O
Molecular Weight: 433.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n1C1CCCC1
Standard InChI: InChI=1S/C24H31N7O/c1-29(2)23(32)21-15-17-16-26-24(28-22(17)31(21)20-5-3-4-6-20)27-18-7-9-19(10-8-18)30-13-11-25-12-14-30/h7-10,15-16,20,25H,3-6,11-14H2,1-2H3,(H,26,27,28)
Standard InChI Key: GIEZCFPNBLPSOM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
34.4981 -13.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4969 -13.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2050 -14.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9146 -13.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9118 -13.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2032 -12.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6230 -14.2438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3301 -13.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7903 -12.6088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0351 -14.2420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0275 -12.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3238 -13.0190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7928 -11.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0890 -11.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3790 -11.7832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3773 -12.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0855 -13.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7428 -13.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7378 -13.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5187 -14.0936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0063 -13.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5267 -12.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7686 -14.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2843 -15.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7606 -16.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5394 -15.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5442 -15.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8235 -13.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2278 -14.1459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2363 -12.7305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0535 -12.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8319 -12.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
1 9 1 0
8 10 2 0
10 19 1 0
18 11 1 0
11 12 2 0
12 8 1 0
9 13 1 0
9 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
20 23 1 0
21 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.56Molecular Weight (Monoisotopic): 433.2590AlogP: 3.40#Rotatable Bonds: 5Polar Surface Area: 78.32Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.91CX LogP: 3.00CX LogD: 1.48Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -1.42
References 1. Poratti M, Marzaro G.. (2019) Third-generation CDK inhibitors: A review on the synthesis and binding modes of Palbociclib, Ribociclib and Abemaciclib., 172 [PMID:30978559 ] [10.1016/j.ejmech.2019.03.064 ]