The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-5-(4-((5-(3-azidophenyl)furan-2-yl)methylene)-5-oxo-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl)-2-chlorobenzoic acid ID: ALA4589116
PubChem CID: 155567903
Max Phase: Preclinical
Molecular Formula: C22H11ClF3N5O4
Molecular Weight: 501.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [N-]=[N+]=Nc1cccc(-c2ccc(/C=C3/C(=O)N(c4ccc(Cl)c(C(=O)O)c4)N=C3C(F)(F)F)o2)c1
Standard InChI: InChI=1S/C22H11ClF3N5O4/c23-17-6-4-13(9-15(17)21(33)34)31-20(32)16(19(29-31)22(24,25)26)10-14-5-7-18(35-14)11-2-1-3-12(8-11)28-30-27/h1-10H,(H,33,34)/b16-10+
Standard InChI Key: VCSVVNFGURGPNF-MHWRWJLKSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
4.5152 -12.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3323 -12.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5867 -11.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9238 -11.0280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2650 -11.5101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8119 -12.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6247 -12.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1733 -13.4689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9203 -13.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8358 -12.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0366 -12.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4899 -11.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3207 -10.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5442 -10.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9362 -10.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1100 -11.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8862 -11.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6245 -13.5455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6222 -14.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3286 -14.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0378 -14.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0361 -13.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3291 -13.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0340 -12.9473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7428 -13.1336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4515 -13.5406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1547 -13.9459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1586 -10.5038 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.5030 -12.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7248 -11.8560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6761 -12.9040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3695 -11.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0770 -11.0328 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0865 -11.7255 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6792 -10.4658 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
2 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
5 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
9 18 1 0
1 24 2 0
22 25 1 0
25 26 2 0
26 27 2 0
15 28 1 0
29 30 1 0
29 31 2 0
16 29 1 0
32 33 1 0
32 34 1 0
32 35 1 0
3 32 1 0
M CHG 2 26 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.81Molecular Weight (Monoisotopic): 501.0452AlogP: 6.59#Rotatable Bonds: 5Polar Surface Area: 131.87Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.86CX Basic pKa: ┄CX LogP: 6.02CX LogD: 2.42Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -1.38
References 1. Hayes KE, Batsomboon P, Chen WC, Johnson BD, Becker A, Eschrich S, Yang Y, Robart AR, Dudley GB, Geldenhuys WJ, Hazlehurst LA.. (2019) Inhibition of the FAD containing ER oxidoreductin 1 (Ero1) protein by EN-460 as a strategy for treatment of multiple myeloma., 27 (8): [PMID:30850265 ] [10.1016/j.bmc.2019.02.016 ]