3-(4,5-diphenyl-1H-imidazol-2-yl)-6-methoxyquinolin-2(1H)-one

ID: ALA4589369

PubChem CID: 155568134

Max Phase: Preclinical

Molecular Formula: C25H19N3O2

Molecular Weight: 393.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]c(=O)c(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)cc2c1

Standard InChI:  InChI=1S/C25H19N3O2/c1-30-19-12-13-21-18(14-19)15-20(25(29)26-21)24-27-22(16-8-4-2-5-9-16)23(28-24)17-10-6-3-7-11-17/h2-15H,1H3,(H,26,29)(H,27,28)

Standard InChI Key:  ZRBTYAQXPSAGAN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   27.3167  -10.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3156  -11.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0236  -12.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0218  -10.4622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7304  -10.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7293  -11.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4355  -12.0972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1474  -11.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1485  -10.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4378  -10.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8539  -12.1007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8572  -10.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6009  -10.7958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1492  -10.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7422   -9.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9426   -9.6491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0744   -8.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8885   -8.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2226   -7.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7437   -7.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9269   -7.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5965   -8.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9587  -10.2780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2885  -11.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1002  -11.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5830  -10.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2483   -9.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4376   -9.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6089  -10.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6087   -9.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 15 17  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 23  1  0
  1 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4589369

    ---

Associated Targets(non-human)

Hmox1 Heme oxygenase 1 (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 393.45Molecular Weight (Monoisotopic): 393.1477AlogP: 5.26#Rotatable Bonds: 4
Polar Surface Area: 70.77Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.64CX Basic pKa: 2.22CX LogP: 4.97CX LogD: 4.95
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -0.71

References

1. Salerno L, Floresta G, Ciaffaglione V, Gentile D, Margani F, Turnaturi R, Rescifina A, Pittalà V..  (2019)  Progress in the development of selective heme oxygenase-1 inhibitors and their potential therapeutic application.,  167  [PMID:30784878] [10.1016/j.ejmech.2019.02.027]

Source