(4Z,7Z,10Z,13Z,16Z,19Z)-N-((4-Methoxycarbonyl)-phenylsulfonyl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4589435

PubChem CID: 155567825

Max Phase: Preclinical

Molecular Formula: C30H39NO5S

Molecular Weight: 525.71

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NS(=O)(=O)c1ccc(C(=O)OC)cc1

Standard InChI:  InChI=1S/C30H39NO5S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(32)31-37(34,35)28-25-23-27(24-26-28)30(33)36-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-26H,3,6,9,12,15,18,21-22H2,1-2H3,(H,31,32)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-

Standard InChI Key:  CPQZSMQVEOZFFI-JDPCYWKWSA-N

Molfile:  

 
     RDKit          2D

 37 37  0  0  0  0  0  0  0  0999 V2000
   16.6451   -5.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2406   -4.4079    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.8317   -5.1110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6645   -4.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3764   -4.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0841   -4.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7959   -4.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9527   -4.0034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6645   -5.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5044   -4.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5059   -5.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2143   -5.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2158   -6.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5089   -6.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5104   -7.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8034   -8.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0950   -7.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3880   -8.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6795   -7.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6780   -6.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9696   -6.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2626   -6.8701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2641   -7.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5572   -8.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5555   -8.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2624   -9.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9709   -8.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5373   -4.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5439   -3.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8378   -2.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1284   -3.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1295   -4.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8362   -4.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4209   -2.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4213   -1.9555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7130   -3.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0055   -2.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  4  9  2  0
  7 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
  8  2  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 34 35  2  0
 34 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4589435

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.71Molecular Weight (Monoisotopic): 525.2549AlogP: 6.76#Rotatable Bonds: 17
Polar Surface Area: 89.54Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.23CX Basic pKa: CX LogP: 7.55CX LogD: 6.61
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: 0.13

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source