The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-cyclopropyl-6-fluoro-7-(4-(2-(1-(4-methoxyphenyl)-1H-tetrazol-5-yl)-2-oxoethyl)piperazin-1-yl)-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid ID: ALA4589649
PubChem CID: 155568398
Max Phase: Preclinical
Molecular Formula: C26H25FN8O5
Molecular Weight: 548.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2nnnc2C(=O)CN2CCN(c3nc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)cc1
Standard InChI: InChI=1S/C26H25FN8O5/c1-40-17-6-4-16(5-7-17)35-25(29-30-31-35)21(36)14-32-8-10-33(11-9-32)24-20(27)12-18-22(37)19(26(38)39)13-34(15-2-3-15)23(18)28-24/h4-7,12-13,15H,2-3,8-11,14H2,1H3,(H,38,39)
Standard InChI Key: DNOHALIIGLJOTL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
16.2200 -18.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2200 -18.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9253 -19.3691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9253 -17.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6306 -18.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6290 -18.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3332 -19.3701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0395 -18.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0371 -18.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3323 -17.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7435 -17.7338 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9253 -16.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5111 -17.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5087 -16.9237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8046 -18.1516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9308 -20.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5232 -20.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3404 -20.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7444 -19.3689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7432 -20.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4473 -20.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1570 -20.1890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1581 -19.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4496 -18.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8636 -20.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5724 -20.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2790 -20.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5747 -19.3758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3624 -21.4148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1613 -21.5869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5718 -20.8803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0267 -20.2716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7574 -21.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9802 -21.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3718 -22.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5395 -23.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3209 -23.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9259 -22.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9315 -23.5947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1546 -23.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
4 12 2 0
1 13 1 0
13 14 2 0
13 15 1 0
17 16 1 0
18 17 1 0
16 18 1 0
3 16 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
8 19 1 0
22 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
29 33 1 0
36 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.54Molecular Weight (Monoisotopic): 548.1932AlogP: 1.56#Rotatable Bonds: 8Polar Surface Area: 148.57Molecular Species: ACIDHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.61CX Basic pKa: 3.72CX LogP: 2.20CX LogD: 0.32Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -1.46