2-ethyl-5-methyl-9-(2-methylpyridin-3-yl)-5,6-dihydrobenzo[c]pyrazolo[4,3-e]azepin-4(2H)-one

ID: ALA4590357

PubChem CID: 146523813

Max Phase: Preclinical

Molecular Formula: C20H20N4O

Molecular Weight: 332.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1cc2c(n1)C(=O)N(C)Cc1ccc(-c3cccnc3C)cc1-2

Standard InChI:  InChI=1S/C20H20N4O/c1-4-24-12-18-17-10-14(16-6-5-9-21-13(16)2)7-8-15(17)11-23(3)20(25)19(18)22-24/h5-10,12H,4,11H2,1-3H3

Standard InChI Key:  CXGMELZHEJKZMF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   24.2128   -9.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1535  -10.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1524  -11.2862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8604  -11.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8587  -10.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5665  -11.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5673  -10.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0186  -10.1236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3758  -10.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4463  -11.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7386  -11.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0310  -11.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0300  -12.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7423  -12.9180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4470  -12.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5265   -9.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1930  -10.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0222  -11.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2152  -11.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1456  -12.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9097  -12.9487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4514  -12.3213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0962  -13.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1555  -12.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8785  -13.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  6  2  0
  7  5  2  0
  5  2  1  0
  6  7  1  0
  7  1  1  0
  6 19  1  0
  1  8  1  0
  8  9  1  0
 18  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  3 10  1  0
  8 16  1  0
  9 17  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 18  2  0
 21 23  1  0
 15 24  1  0
 23 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4590357

    ---

Associated Targets(Human)

GRM3 Tchem Metabotropic glutamate receptor 3 (732 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.41Molecular Weight (Monoisotopic): 332.1637AlogP: 3.53#Rotatable Bonds: 2
Polar Surface Area: 51.02Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.50CX LogP: 2.40CX LogD: 2.40
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: -0.70

References

1. Kargbo RB..  (2019)  Allosteric mGluR3 Modulators for the Treatment of Psychiatric Disorders.,  10  (2): [PMID:30783491] [10.1021/acsmedchemlett.8b00619]

Source