2-(4-chloro-2-fluorophenylamino)-3,4-difluoro-N-(3-hydroxypropoxy)benzamide

ID: ALA4590482

PubChem CID: 155567646

Max Phase: Preclinical

Molecular Formula: C16H14ClF3N2O3

Molecular Weight: 374.75

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NOCCCO)c1ccc(F)c(F)c1Nc1ccc(Cl)cc1F

Standard InChI:  InChI=1S/C16H14ClF3N2O3/c17-9-2-5-13(12(19)8-9)21-15-10(3-4-11(18)14(15)20)16(24)22-25-7-1-6-23/h2-5,8,21,23H,1,6-7H2,(H,22,24)

Standard InChI Key:  MUYVRWDNOMMBDN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   33.9161  -17.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9150  -18.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6230  -18.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3327  -18.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3299  -17.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6213  -16.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6228  -19.2810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3305  -19.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3261  -20.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0329  -20.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7417  -20.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7393  -19.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0319  -19.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2070  -18.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4996  -18.0537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2063  -19.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7916  -18.4617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7909  -19.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0829  -19.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0822  -20.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3742  -20.9122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6172  -20.9116    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.0411  -18.4618    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.0360  -16.8204    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.4498  -20.9132    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  2 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  9 22  1  0
  4 23  1  0
  5 24  1  0
 11 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4590482

    ---

Associated Targets(Human)

MAP2K1 Tclin Dual specificity mitogen-activated protein kinase kinase 1 (4127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.75Molecular Weight (Monoisotopic): 374.0645AlogP: 3.54#Rotatable Bonds: 7
Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.99CX Basic pKa: CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.51Np Likeness Score: -1.34

References

1. Bauer MR, Mackey MD..  (2019)  Electrostatic Complementarity as a Fast and Effective Tool to Optimize Binding and Selectivity of Protein-Ligand Complexes.,  62  (6): [PMID:30807144] [10.1021/acs.jmedchem.8b01925]

Source