Lycosinine B

ID: ALA4590545

PubChem CID: 86083058

Max Phase: Preclinical

Molecular Formula: C18H19NO3

Molecular Weight: 297.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C=O)c(-c2cccc3c2N(C)CC3)cc1OC

Standard InChI:  InChI=1S/C18H19NO3/c1-19-8-7-12-5-4-6-14(18(12)19)15-10-17(22-3)16(21-2)9-13(15)11-20/h4-6,9-11H,7-8H2,1-3H3

Standard InChI Key:  OTBKNZMJMRPCCA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    6.7507  -25.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7496  -26.6931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4576  -27.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1673  -26.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1645  -25.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4558  -25.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8676  -25.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5771  -25.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2828  -25.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2802  -24.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8632  -24.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5617  -24.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3845  -23.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5765  -23.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2544  -24.1095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4331  -24.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0429  -25.4651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0427  -24.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0416  -27.1011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3342  -26.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8756  -27.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8769  -27.9173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 12  1  0
 11  7  1  0
  5  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  1  0
  1 17  1  0
 17 18  1  0
  2 19  1  0
 19 20  1  0
  4 21  1  0
 21 22  2  0
M  END

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 297.35Molecular Weight (Monoisotopic): 297.1365AlogP: 3.18#Rotatable Bonds: 4
Polar Surface Area: 38.77Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.09CX LogP: 3.17CX LogD: 3.17
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.81Np Likeness Score: 0.46

References

1. Nair JJ, van Staden J..  (2019)  Antiprotozoal alkaloid principles of the plant family Amaryllidaceae.,  29  (20): [PMID:31515186] [10.1016/j.bmcl.2019.126642]

Source