6-(2-Fluorophenyl)-N,N-bis(pyridin-2-ylmethyl)pyrimidin-4-amine

ID: ALA4590635

PubChem CID: 155567650

Max Phase: Preclinical

Molecular Formula: C22H18FN5

Molecular Weight: 371.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1ccccc1-c1cc(N(Cc2ccccn2)Cc2ccccn2)ncn1

Standard InChI:  InChI=1S/C22H18FN5/c23-20-10-2-1-9-19(20)21-13-22(27-16-26-21)28(14-17-7-3-5-11-24-17)15-18-8-4-6-12-25-18/h1-13,16H,14-15H2

Standard InChI Key:  HKMGBPUXYJCXCB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    4.1547  -14.6970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1536  -15.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8616  -15.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5713  -15.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5684  -14.6934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8598  -14.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4455  -15.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7398  -15.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0322  -15.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0311  -16.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7435  -17.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4481  -16.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2796  -15.9236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2809  -16.7408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9867  -15.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5738  -17.1505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6950  -15.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8685  -16.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1620  -17.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1628  -17.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8761  -18.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5798  -17.9622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6917  -16.7370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3992  -17.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1072  -16.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1033  -15.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3952  -15.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7416  -14.6968    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  1  0
 13 14  1  0
 13 15  1  0
 14 16  1  0
 15 17  1  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 17 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 17  1  0
  8 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4590635

    ---

Associated Targets(Human)

CHRNB2 Tclin Neuronal acetylcholine receptor; alpha4/beta2 (3972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR3A Tclin Serotonin 3a (5-HT3a) receptor (3366 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CHRNA7 Tchem Neuronal acetylcholine receptor protein alpha-7 subunit (3524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.42Molecular Weight (Monoisotopic): 371.1546AlogP: 4.28#Rotatable Bonds: 6
Polar Surface Area: 54.80Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.51CX LogP: 4.10CX LogD: 4.10
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: -1.32

References

1. Camacho-Hernandez GA, Stokes C, Duggan BM, Kaczanowska K, Brandao-Araiza S, Doan L, Papke RL, Taylor P..  (2019)  Synthesis, Pharmacological Characterization, and Structure-Activity Relationships of Noncanonical Selective Agonists for α7 nAChRs.,  62  (22): [PMID:31675224] [10.1021/acs.jmedchem.9b01467]

Source