The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-(6-Amino-2-methyl-9H-purin-9-yl)azetidin-1-yl)(5-((1-cycloheptylpiperidin-4-yl)methyl)-1-methyl-1H-pyrazol-3-yl)methanone ID: ALA4590955
PubChem CID: 155568735
Max Phase: Preclinical
Molecular Formula: C27H39N9O
Molecular Weight: 505.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(N)c2ncn(C3CN(C(=O)c4cc(CC5CCN(C6CCCCCC6)CC5)n(C)n4)C3)c2n1
Standard InChI: InChI=1S/C27H39N9O/c1-18-30-25(28)24-26(31-18)36(17-29-24)22-15-35(16-22)27(37)23-14-21(33(2)32-23)13-19-9-11-34(12-10-19)20-7-5-3-4-6-8-20/h14,17,19-20,22H,3-13,15-16H2,1-2H3,(H2,28,30,31)
Standard InChI Key: QIJVISXVDBWWRZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
10.4045 -23.1028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1183 -22.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1154 -21.8624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4027 -21.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6923 -22.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6935 -21.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9132 -21.6155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4322 -22.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9112 -22.9449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6576 -23.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9218 -24.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2959 -24.8266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0246 -24.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0381 -25.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2344 -25.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5881 -26.2198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6295 -25.2285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9171 -25.6401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0858 -26.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9025 -26.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5340 -27.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7308 -26.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4829 -26.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6836 -25.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1285 -26.5348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3825 -27.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1875 -27.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3989 -20.6358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1669 -25.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8270 -23.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3307 -26.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8299 -27.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0109 -27.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1385 -25.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4993 -26.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3962 -25.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6649 -25.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 10 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
4 28 1 0
18 29 1 0
2 30 1 0
31 32 1 0
32 33 1 0
31 34 1 0
33 35 1 0
34 36 1 0
35 37 1 0
36 37 1 0
25 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.67Molecular Weight (Monoisotopic): 505.3278AlogP: 3.12#Rotatable Bonds: 5Polar Surface Area: 110.99Molecular Species: BASEHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.52CX LogP: 2.68CX LogD: -0.33Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -1.04
References 1. Taylor AP, Swewczyk M, Kennedy S, Trush VV, Wu H, Zeng H, Dong A, Ferreira de Freitas R, Tatlock J, Kumpf RA, Wythes M, Casimiro-Garcia A, Denny RA, Parikh MD, Li F, Barsyte-Lovejoy D, Schapira M, Vedadi M, Brown PJ, Arrowsmith CH, Owen DR.. (2019) Selective, Small-Molecule Co-Factor Binding Site Inhibition of a Su(var)3-9, Enhancer of Zeste, Trithorax Domain Containing Lysine Methyltransferase., 62 (17): [PMID:31415173 ] [10.1021/acs.jmedchem.9b00112 ]