2-amino-6-((4-fluorophenyl)thio)-N-(2-methoxyphenyl)benzamide

ID: ALA4591113

PubChem CID: 155568371

Max Phase: Preclinical

Molecular Formula: C20H17FN2O2S

Molecular Weight: 368.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1NC(=O)c1c(N)cccc1Sc1ccc(F)cc1

Standard InChI:  InChI=1S/C20H17FN2O2S/c1-25-17-7-3-2-6-16(17)23-20(24)19-15(22)5-4-8-18(19)26-14-11-9-13(21)10-12-14/h2-12H,22H2,1H3,(H,23,24)

Standard InChI Key:  NPRSAJYHUZCSOH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   37.8948  -13.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8936  -14.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6017  -14.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3114  -14.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3085  -13.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5999  -13.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0147  -13.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7239  -13.7182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0116  -12.4951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4301  -13.3069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1378  -13.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8434  -13.3057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8408  -12.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1266  -12.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4238  -12.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0197  -14.9537    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.0210  -15.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3126  -16.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3135  -16.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0224  -17.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7318  -16.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7274  -16.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5975  -12.5011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1388  -14.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4316  -14.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0248  -18.2209    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  6 23  1  0
 11 24  1  0
 24 25  1  0
 20 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4591113

    ---

Associated Targets(Human)

H9 (1832 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.43Molecular Weight (Monoisotopic): 368.0995AlogP: 4.82#Rotatable Bonds: 5
Polar Surface Area: 64.35Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.82CX LogP: 5.06CX LogD: 5.06
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.63Np Likeness Score: -1.52

References

1. Zhang RH, Wang S, Luo RH, Zhou M, Zhang H, Xu GB, Zhao YL, Li YJ, Wang YL, Yan G, Liao SG, Zheng YT, Li R..  (2019)  Design, synthesis, and biological evaluation of 2-amino-N-(2-methoxyphenyl)-6-((4-nitrophenyl)sulfonyl)benzamide derivatives as potent HIV-1 Vif inhibitors.,  29  (24): [PMID:31685340] [10.1016/j.bmcl.2019.126638]

Source